C17H20N2O8 — CID 175586372
3-(1-azatricyclo[6.3.1.04,12]dodeca-2,4,6,8(12)-tetraen-3-yl)-2,3,4,5,6-pentahydroxy-2-nitrohexanal (PubChem CID 175586372) has the molecular formula C17H20N2O8 and a molecular weight of 380.35 g/mol. Its IUPAC name is 3-(1-azatricyclo[6.3.1.04,12]dodeca-2,4,6,8(12)-tetraen-3-yl)-2,3,4,5,6-pentahydroxy-2-nitrohexanal.
| Compound Name | 3-(1-azatricyclo[6.3.1.04,12]dodeca-2,4,6,8(12)-tetraen-3-yl)-2,3,4,5,6-pentahydroxy-2-nitrohexanal |
|---|---|
| PubChem CID | 175586372 |
| Molecular Formula | C17H20N2O8 |
| Molecular Weight | 380.35 g/mol |
| Exact Mass | 380.12 |
| IUPAC Name | 3-(1-azatricyclo[6.3.1.04,12]dodeca-2,4,6,8(12)-tetraen-3-yl)-2,3,4,5,6-pentahydroxy-2-nitrohexanal |
| SMILES | O=CC(O)([N+](=O)[O-])C(O)(c1cn2c3c(cccc13)CCC2)C(O)C(O)CO |
| InChI | InChI=1S/C17H20N2O8/c20-8-13(22)15(23)17(25,16(24,9-21)19(26)27)12-7-18-6-2-4-10-3-1-5-11(12)14(10)18/h1,3,5,7,9,13,15,20,22-25H,2,4,6,8H2 |
| InChIKey | LNHHRJSVYBSZLY-UHFFFAOYSA-N |
| XLogP | -1.35 |
| TPSA | 166.29 Ų |
| H-Bond Donors | 5 |
| H-Bond Acceptors | 9 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 27 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 380.35 |
| LogP ≤ 5 | -1.35 |
| H-Bond Donors ≤ 5 | 5 |
| H-Bond Acceptors ≤ 10 | 9 |
| Structural Alerts | {'alert_name': 'aldehyde', 'substructure': 'N/A'}, {'alert_name': 'het-C-het_not_in_ring', 'substructure': 'N/A'}, {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|