About methyl 3-(3-chloro-5,5-difluoroazepan-1-yl)pyridazine-4-carboxylate
methyl 3-(3-chloro-5,5-difluoroazepan-1-yl)pyridazine-4-carboxylate (PubChem CID 175586612) has the molecular formula C12H14ClF2N3O2
and a molecular weight of 305.71 g/mol. Its IUPAC name is methyl 3-(3-chloro-5,5-difluoroazepan-1-yl)pyridazine-4-carboxylate.
Molecular Properties
| Compound Name | methyl 3-(3-chloro-5,5-difluoroazepan-1-yl)pyridazine-4-carboxylate |
| PubChem CID | 175586612 |
| Molecular Formula | C12H14ClF2N3O2 |
| Molecular Weight | 305.71 g/mol |
| Exact Mass | 305.07 |
| IUPAC Name | methyl 3-(3-chloro-5,5-difluoroazepan-1-yl)pyridazine-4-carboxylate |
| SMILES | COC(=O)c1ccnnc1N1CCC(F)(F)CC(Cl)C1 |
| InChI | InChI=1S/C12H14ClF2N3O2/c1-20-11(19)9-2-4-16-17-10(9)18-5-3-12(14,15)6-8(13)7-18/h2,4,8H,3,5-7H2,1H3 |
| InChIKey | DSQVVQJSLQIYLZ-UHFFFAOYSA-N |
| XLogP | 2.11 |
| TPSA | 55.32 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 20 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 305.71 |
| LogP ≤ 5 | 2.11 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 5 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'alkyl_halide', 'substructure': 'N/A'} |
|---|
Analyze methyl 3-(3-chloro-5,5-difluoroazepan-1-yl)pyridazine-4-carboxylate with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of methyl 3-(3-chloro-5,5-difluoroazepan-1-yl)pyridazine-4-carboxylate?
The IUPAC name of methyl 3-(3-chloro-5,5-difluoroazepan-1-yl)pyridazine-4-carboxylate (CID 175586612) is methyl 3-(3-chloro-5,5-difluoroazepan-1-yl)pyridazine-4-carboxylate.
What is the SMILES notation for methyl 3-(3-chloro-5,5-difluoroazepan-1-yl)pyridazine-4-carboxylate?
The canonical SMILES for methyl 3-(3-chloro-5,5-difluoroazepan-1-yl)pyridazine-4-carboxylate is COC(=O)c1ccnnc1N1CCC(F)(F)CC(Cl)C1.
What is the InChIKey of methyl 3-(3-chloro-5,5-difluoroazepan-1-yl)pyridazine-4-carboxylate?
The InChIKey is DSQVVQJSLQIYLZ-UHFFFAOYSA-N. The full InChI is InChI=1S/C12H14ClF2N3O2/c1-20-11(19)9-2-4-16-17-10(9)18-5-3-12(14,15)6-8(13)7-18/h2,4,8H,3,5-7H2,1H3.
What are the key properties of methyl 3-(3-chloro-5,5-difluoroazepan-1-yl)pyridazine-4-carboxylate?
methyl 3-(3-chloro-5,5-difluoroazepan-1-yl)pyridazine-4-carboxylate has a molecular weight of 305.71 g/mol, XLogP of 2.11, 2 rotatable bonds, 0 hydrogen bond donors, and 5 hydrogen bond acceptors.
Where does this data come from?
All data for methyl 3-(3-chloro-5,5-difluoroazepan-1-yl)pyridazine-4-carboxylate is sourced from PubChem (CID 175586612), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).