About 4-[(E)-2-(2-fluoro-3,5-dimethoxy-4-propan-2-ylphenyl)ethenyl]pyridine
4-[(E)-2-(2-fluoro-3,5-dimethoxy-4-propan-2-ylphenyl)ethenyl]pyridine (PubChem CID 175586718) has the molecular formula C18H20FNO2
and a molecular weight of 301.36 g/mol. Its IUPAC name is 4-[(E)-2-(2-fluoro-3,5-dimethoxy-4-propan-2-ylphenyl)ethenyl]pyridine.
Molecular Properties
| Compound Name | 4-[(E)-2-(2-fluoro-3,5-dimethoxy-4-propan-2-ylphenyl)ethenyl]pyridine |
| PubChem CID | 175586718 |
| Molecular Formula | C18H20FNO2 |
| Molecular Weight | 301.36 g/mol |
| Exact Mass | 301.15 |
| IUPAC Name | 4-[(E)-2-(2-fluoro-3,5-dimethoxy-4-propan-2-ylphenyl)ethenyl]pyridine |
| SMILES | COc1cc(/C=C/c2ccncc2)c(F)c(OC)c1C(C)C |
| InChI | InChI=1S/C18H20FNO2/c1-12(2)16-15(21-3)11-14(17(19)18(16)22-4)6-5-13-7-9-20-10-8-13/h5-12H,1-4H3/b6-5+ |
| InChIKey | XAAQNNHMTAPUOD-AATRIKPKSA-N |
| XLogP | 4.53 |
| TPSA | 31.35 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 22 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 301.36 |
| LogP ≤ 5 | 4.53 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |
Analyze 4-[(E)-2-(2-fluoro-3,5-dimethoxy-4-propan-2-ylphenyl)ethenyl]pyridine with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 4-[(E)-2-(2-fluoro-3,5-dimethoxy-4-propan-2-ylphenyl)ethenyl]pyridine?
The IUPAC name of 4-[(E)-2-(2-fluoro-3,5-dimethoxy-4-propan-2-ylphenyl)ethenyl]pyridine (CID 175586718) is 4-[(E)-2-(2-fluoro-3,5-dimethoxy-4-propan-2-ylphenyl)ethenyl]pyridine.
What is the SMILES notation for 4-[(E)-2-(2-fluoro-3,5-dimethoxy-4-propan-2-ylphenyl)ethenyl]pyridine?
The canonical SMILES for 4-[(E)-2-(2-fluoro-3,5-dimethoxy-4-propan-2-ylphenyl)ethenyl]pyridine is COc1cc(/C=C/c2ccncc2)c(F)c(OC)c1C(C)C.
What is the InChIKey of 4-[(E)-2-(2-fluoro-3,5-dimethoxy-4-propan-2-ylphenyl)ethenyl]pyridine?
The InChIKey is XAAQNNHMTAPUOD-AATRIKPKSA-N. The full InChI is InChI=1S/C18H20FNO2/c1-12(2)16-15(21-3)11-14(17(19)18(16)22-4)6-5-13-7-9-20-10-8-13/h5-12H,1-4H3/b6-5+.
What are the key properties of 4-[(E)-2-(2-fluoro-3,5-dimethoxy-4-propan-2-ylphenyl)ethenyl]pyridine?
4-[(E)-2-(2-fluoro-3,5-dimethoxy-4-propan-2-ylphenyl)ethenyl]pyridine has a molecular weight of 301.36 g/mol, XLogP of 4.53, 5 rotatable bonds, 0 hydrogen bond donors, and 3 hydrogen bond acceptors.
Where does this data come from?
All data for 4-[(E)-2-(2-fluoro-3,5-dimethoxy-4-propan-2-ylphenyl)ethenyl]pyridine is sourced from PubChem (CID 175586718), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).