About N,2-dimethyl-7-[[5-(trifluoromethyl)-2-pyridinyl]oxy]-1,3-benzothiazol-4-amine
N,2-dimethyl-7-[[5-(trifluoromethyl)-2-pyridinyl]oxy]-1,3-benzothiazol-4-amine (PubChem CID 175588178) has the molecular formula C15H12F3N3OS
and a molecular weight of 339.34 g/mol. Its IUPAC name is N,2-dimethyl-7-[[5-(trifluoromethyl)-2-pyridinyl]oxy]-1,3-benzothiazol-4-amine.
Molecular Properties
| Compound Name | N,2-dimethyl-7-[[5-(trifluoromethyl)-2-pyridinyl]oxy]-1,3-benzothiazol-4-amine |
| PubChem CID | 175588178 |
| Molecular Formula | C15H12F3N3OS |
| Molecular Weight | 339.34 g/mol |
| Exact Mass | 339.07 |
| IUPAC Name | N,2-dimethyl-7-[[5-(trifluoromethyl)-2-pyridinyl]oxy]-1,3-benzothiazol-4-amine |
| SMILES | CNc1ccc(Oc2ccc(C(F)(F)F)cn2)c2sc(C)nc12 |
| InChI | InChI=1S/C15H12F3N3OS/c1-8-21-13-10(19-2)4-5-11(14(13)23-8)22-12-6-3-9(7-20-12)15(16,17)18/h3-7,19H,1-2H3 |
| InChIKey | OUQRLSWPEHLCQE-UHFFFAOYSA-N |
| XLogP | 4.85 |
| TPSA | 47.04 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 23 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 339.34 |
| LogP ≤ 5 | 4.85 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
Analyze N,2-dimethyl-7-[[5-(trifluoromethyl)-2-pyridinyl]oxy]-1,3-benzothiazol-4-amine with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of N,2-dimethyl-7-[[5-(trifluoromethyl)-2-pyridinyl]oxy]-1,3-benzothiazol-4-amine?
The IUPAC name of N,2-dimethyl-7-[[5-(trifluoromethyl)-2-pyridinyl]oxy]-1,3-benzothiazol-4-amine (CID 175588178) is N,2-dimethyl-7-[[5-(trifluoromethyl)-2-pyridinyl]oxy]-1,3-benzothiazol-4-amine.
What is the SMILES notation for N,2-dimethyl-7-[[5-(trifluoromethyl)-2-pyridinyl]oxy]-1,3-benzothiazol-4-amine?
The canonical SMILES for N,2-dimethyl-7-[[5-(trifluoromethyl)-2-pyridinyl]oxy]-1,3-benzothiazol-4-amine is CNc1ccc(Oc2ccc(C(F)(F)F)cn2)c2sc(C)nc12.
What is the InChIKey of N,2-dimethyl-7-[[5-(trifluoromethyl)-2-pyridinyl]oxy]-1,3-benzothiazol-4-amine?
The InChIKey is OUQRLSWPEHLCQE-UHFFFAOYSA-N. The full InChI is InChI=1S/C15H12F3N3OS/c1-8-21-13-10(19-2)4-5-11(14(13)23-8)22-12-6-3-9(7-20-12)15(16,17)18/h3-7,19H,1-2H3.
What are the key properties of N,2-dimethyl-7-[[5-(trifluoromethyl)-2-pyridinyl]oxy]-1,3-benzothiazol-4-amine?
N,2-dimethyl-7-[[5-(trifluoromethyl)-2-pyridinyl]oxy]-1,3-benzothiazol-4-amine has a molecular weight of 339.34 g/mol, XLogP of 4.85, 3 rotatable bonds, 1 hydrogen bond donors, and 5 hydrogen bond acceptors.
Where does this data come from?
All data for N,2-dimethyl-7-[[5-(trifluoromethyl)-2-pyridinyl]oxy]-1,3-benzothiazol-4-amine is sourced from PubChem (CID 175588178), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).