About 3,5-bis[(3,5-dichloro-4-hydroxyphenyl)methylidene]piperidin-4-one
3,5-bis[(3,5-dichloro-4-hydroxyphenyl)methylidene]piperidin-4-one (PubChem CID 175588365) has the molecular formula C19H13Cl4NO3
and a molecular weight of 445.13 g/mol. Its IUPAC name is 3,5-bis[(3,5-dichloro-4-hydroxyphenyl)methylidene]piperidin-4-one.
Molecular Properties
| Compound Name | 3,5-bis[(3,5-dichloro-4-hydroxyphenyl)methylidene]piperidin-4-one |
| PubChem CID | 175588365 |
| Molecular Formula | C19H13Cl4NO3 |
| Molecular Weight | 445.13 g/mol |
| Exact Mass | 442.96 |
| IUPAC Name | 3,5-bis[(3,5-dichloro-4-hydroxyphenyl)methylidene]piperidin-4-one |
| SMILES | O=C1C(=Cc2cc(Cl)c(O)c(Cl)c2)CNCC1=Cc1cc(Cl)c(O)c(Cl)c1 |
| InChI | InChI=1S/C19H13Cl4NO3/c20-13-3-9(4-14(21)18(13)26)1-11-7-24-8-12(17(11)25)2-10-5-15(22)19(27)16(23)6-10/h1-6,24,26-27H,7-8H2 |
| InChIKey | JILRFGYLJUOIJI-UHFFFAOYSA-N |
| XLogP | 5.35 |
| TPSA | 69.56 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 27 |
| Complexity | — |
Lipinski Rule of Five
1 violation
| Rule | Value |
| MW ≤ 500 | 445.13 |
| LogP ≤ 5 | 5.35 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 4 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'ene_one_ene_A(57)', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|
Analyze 3,5-bis[(3,5-dichloro-4-hydroxyphenyl)methylidene]piperidin-4-one with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 3,5-bis[(3,5-dichloro-4-hydroxyphenyl)methylidene]piperidin-4-one?
The IUPAC name of 3,5-bis[(3,5-dichloro-4-hydroxyphenyl)methylidene]piperidin-4-one (CID 175588365) is 3,5-bis[(3,5-dichloro-4-hydroxyphenyl)methylidene]piperidin-4-one.
What is the SMILES notation for 3,5-bis[(3,5-dichloro-4-hydroxyphenyl)methylidene]piperidin-4-one?
The canonical SMILES for 3,5-bis[(3,5-dichloro-4-hydroxyphenyl)methylidene]piperidin-4-one is O=C1C(=Cc2cc(Cl)c(O)c(Cl)c2)CNCC1=Cc1cc(Cl)c(O)c(Cl)c1.
What is the InChIKey of 3,5-bis[(3,5-dichloro-4-hydroxyphenyl)methylidene]piperidin-4-one?
The InChIKey is JILRFGYLJUOIJI-UHFFFAOYSA-N. The full InChI is InChI=1S/C19H13Cl4NO3/c20-13-3-9(4-14(21)18(13)26)1-11-7-24-8-12(17(11)25)2-10-5-15(22)19(27)16(23)6-10/h1-6,24,26-27H,7-8H2.
What are the key properties of 3,5-bis[(3,5-dichloro-4-hydroxyphenyl)methylidene]piperidin-4-one?
3,5-bis[(3,5-dichloro-4-hydroxyphenyl)methylidene]piperidin-4-one has a molecular weight of 445.13 g/mol, XLogP of 5.35, 2 rotatable bonds, 3 hydrogen bond donors, and 4 hydrogen bond acceptors.
Where does this data come from?
All data for 3,5-bis[(3,5-dichloro-4-hydroxyphenyl)methylidene]piperidin-4-one is sourced from PubChem (CID 175588365), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).