C22H22F4N2O4S2 — CID 175589860
2-tert-butylperoxy-N-[4-cyano-3-(trifluoromethyl)phenyl]-3-(4-fluorophenyl)sulfonothioyl-2-methylpropanamide (PubChem CID 175589860) has the molecular formula C22H22F4N2O4S2 and a molecular weight of 518.55 g/mol. Its IUPAC name is 2-tert-butylperoxy-N-[4-cyano-3-(trifluoromethyl)phenyl]-3-(4-fluorophenyl)sulfonothioyl-2-methylpropanamide.
| Compound Name | 2-tert-butylperoxy-N-[4-cyano-3-(trifluoromethyl)phenyl]-3-(4-fluorophenyl)sulfonothioyl-2-methylpropanamide |
|---|---|
| PubChem CID | 175589860 |
| Molecular Formula | C22H22F4N2O4S2 |
| Molecular Weight | 518.55 g/mol |
| Exact Mass | 518.10 |
| IUPAC Name | 2-tert-butylperoxy-N-[4-cyano-3-(trifluoromethyl)phenyl]-3-(4-fluorophenyl)sulfonothioyl-2-methylpropanamide |
| SMILES | CC(C)(C)OOC(C)(CS(=O)(=S)c1ccc(F)cc1)C(=O)Nc1ccc(C#N)c(C(F)(F)F)c1 |
| InChI | InChI=1S/C22H22F4N2O4S2/c1-20(2,3)31-32-21(4,13-34(30,33)17-9-6-15(23)7-10-17)19(29)28-16-8-5-14(12-27)18(11-16)22(24,25)26/h5-11H,13H2,1-4H3,(H,28,29) |
| InChIKey | ITZVEVUZDTWQJA-UHFFFAOYSA-N |
| XLogP | 4.97 |
| TPSA | 88.42 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 34 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 518.55 |
| LogP ≤ 5 | 4.97 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'}, {'alert_name': 'peroxide', 'substructure': 'N/A'} |
|---|