About [(2R)-3,4-difluoropyrrolidin-2-yl]methanol
[(2R)-3,4-difluoropyrrolidin-2-yl]methanol (PubChem CID 175590240) has the molecular formula C5H9F2NO
and a molecular weight of 137.13 g/mol. Its IUPAC name is [(2R)-3,4-difluoropyrrolidin-2-yl]methanol.
Molecular Properties
| Compound Name | [(2R)-3,4-difluoropyrrolidin-2-yl]methanol |
| PubChem CID | 175590240 |
| Molecular Formula | C5H9F2NO |
| Molecular Weight | 137.13 g/mol |
| Exact Mass | 137.07 |
| IUPAC Name | [(2R)-3,4-difluoropyrrolidin-2-yl]methanol |
| SMILES | OC[C@H]1NCC(F)C1F |
| InChI | InChI=1S/C5H9F2NO/c6-3-1-8-4(2-9)5(3)7/h3-5,8-9H,1-2H2/t3?,4-,5?/m1/s1 |
| InChIKey | UQZNLEKGKBCMLK-ACHVEOLNSA-N |
| XLogP | -0.37 |
| TPSA | 32.26 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 9 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 137.13 |
| LogP ≤ 5 | -0.37 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 2 |
Analyze [(2R)-3,4-difluoropyrrolidin-2-yl]methanol with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of [(2R)-3,4-difluoropyrrolidin-2-yl]methanol?
The IUPAC name of [(2R)-3,4-difluoropyrrolidin-2-yl]methanol (CID 175590240) is [(2R)-3,4-difluoropyrrolidin-2-yl]methanol.
What is the SMILES notation for [(2R)-3,4-difluoropyrrolidin-2-yl]methanol?
The canonical SMILES for [(2R)-3,4-difluoropyrrolidin-2-yl]methanol is OC[C@H]1NCC(F)C1F.
What is the InChIKey of [(2R)-3,4-difluoropyrrolidin-2-yl]methanol?
The InChIKey is UQZNLEKGKBCMLK-ACHVEOLNSA-N. The full InChI is InChI=1S/C5H9F2NO/c6-3-1-8-4(2-9)5(3)7/h3-5,8-9H,1-2H2/t3?,4-,5?/m1/s1.
What are the key properties of [(2R)-3,4-difluoropyrrolidin-2-yl]methanol?
[(2R)-3,4-difluoropyrrolidin-2-yl]methanol has a molecular weight of 137.13 g/mol, XLogP of -0.37, 1 rotatable bonds, 2 hydrogen bond donors, and 2 hydrogen bond acceptors.
Where does this data come from?
All data for [(2R)-3,4-difluoropyrrolidin-2-yl]methanol is sourced from PubChem (CID 175590240), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).