C35H49ClN2 — CID 175590458
2-chloro-3-N,3-N-bis(3,5-ditert-butylphenyl)-5-methylbenzene-1,3-diamine (PubChem CID 175590458) has the molecular formula C35H49ClN2 and a molecular weight of 533.24 g/mol. Its IUPAC name is 2-chloro-3-N,3-N-bis(3,5-ditert-butylphenyl)-5-methylbenzene-1,3-diamine.
| Compound Name | 2-chloro-3-N,3-N-bis(3,5-ditert-butylphenyl)-5-methylbenzene-1,3-diamine |
|---|---|
| PubChem CID | 175590458 |
| Molecular Formula | C35H49ClN2 |
| Molecular Weight | 533.24 g/mol |
| Exact Mass | 532.36 |
| IUPAC Name | 2-chloro-3-N,3-N-bis(3,5-ditert-butylphenyl)-5-methylbenzene-1,3-diamine |
| SMILES | Cc1cc(N)c(Cl)c(N(c2cc(C(C)(C)C)cc(C(C)(C)C)c2)c2cc(C(C)(C)C)cc(C(C)(C)C)c2)c1 |
| InChI | InChI=1S/C35H49ClN2/c1-22-14-29(37)31(36)30(15-22)38(27-18-23(32(2,3)4)16-24(19-27)33(5,6)7)28-20-25(34(8,9)10)17-26(21-28)35(11,12)13/h14-21H,37H2,1-13H3 |
| InChIKey | VTFMSSSOVLNYPC-UHFFFAOYSA-N |
| XLogP | 10.89 |
| TPSA | 29.26 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 38 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 533.24 |
| LogP ≤ 5 | 10.89 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'aniline', 'substructure': 'N/A'} |
|---|