About azetidine-3-carbonitrile;benzylbenzene
azetidine-3-carbonitrile;benzylbenzene (PubChem CID 175590459) has the molecular formula C17H18N2
and a molecular weight of 250.35 g/mol. Its IUPAC name is azetidine-3-carbonitrile;benzylbenzene.
Molecular Properties
| Compound Name | azetidine-3-carbonitrile;benzylbenzene |
| PubChem CID | 175590459 |
| Molecular Formula | C17H18N2 |
| Molecular Weight | 250.35 g/mol |
| Exact Mass | 250.15 |
| IUPAC Name | azetidine-3-carbonitrile;benzylbenzene |
| SMILES | N#CC1CNC1.c1ccc(Cc2ccccc2)cc1 |
| InChI | InChI=1S/C13H12.C4H6N2/c1-3-7-12(8-4-1)11-13-9-5-2-6-10-13;5-1-4-2-6-3-4/h1-10H,11H2;4,6H,2-3H2 |
| InChIKey | IVLLYAXFZNOEKB-UHFFFAOYSA-N |
| XLogP | 3.01 |
| TPSA | 35.82 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 19 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 250.35 |
| LogP ≤ 5 | 3.01 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |
Analyze azetidine-3-carbonitrile;benzylbenzene with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of azetidine-3-carbonitrile;benzylbenzene?
The IUPAC name of azetidine-3-carbonitrile;benzylbenzene (CID 175590459) is azetidine-3-carbonitrile;benzylbenzene.
What is the SMILES notation for azetidine-3-carbonitrile;benzylbenzene?
The canonical SMILES for azetidine-3-carbonitrile;benzylbenzene is N#CC1CNC1.c1ccc(Cc2ccccc2)cc1.
What is the InChIKey of azetidine-3-carbonitrile;benzylbenzene?
The InChIKey is IVLLYAXFZNOEKB-UHFFFAOYSA-N. The full InChI is InChI=1S/C13H12.C4H6N2/c1-3-7-12(8-4-1)11-13-9-5-2-6-10-13;5-1-4-2-6-3-4/h1-10H,11H2;4,6H,2-3H2.
What are the key properties of azetidine-3-carbonitrile;benzylbenzene?
azetidine-3-carbonitrile;benzylbenzene has a molecular weight of 250.35 g/mol, XLogP of 3.01, 2 rotatable bonds, 1 hydrogen bond donors, and 2 hydrogen bond acceptors.
Where does this data come from?
All data for azetidine-3-carbonitrile;benzylbenzene is sourced from PubChem (CID 175590459), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).