About [4-chloro-6-(2,5-difluorophenyl)pyrimidin-5-yl] carbamate
[4-chloro-6-(2,5-difluorophenyl)pyrimidin-5-yl] carbamate (PubChem CID 175590753) has the molecular formula C11H6ClF2N3O2
and a molecular weight of 285.64 g/mol. Its IUPAC name is [4-chloro-6-(2,5-difluorophenyl)pyrimidin-5-yl] carbamate.
Molecular Properties
| Compound Name | [4-chloro-6-(2,5-difluorophenyl)pyrimidin-5-yl] carbamate |
| PubChem CID | 175590753 |
| Molecular Formula | C11H6ClF2N3O2 |
| Molecular Weight | 285.64 g/mol |
| Exact Mass | 285.01 |
| IUPAC Name | [4-chloro-6-(2,5-difluorophenyl)pyrimidin-5-yl] carbamate |
| SMILES | NC(=O)Oc1c(Cl)ncnc1-c1cc(F)ccc1F |
| InChI | InChI=1S/C11H6ClF2N3O2/c12-10-9(19-11(15)18)8(16-4-17-10)6-3-5(13)1-2-7(6)14/h1-4H,(H2,15,18) |
| InChIKey | XPKBJYRFJHPDTQ-UHFFFAOYSA-N |
| XLogP | 2.53 |
| TPSA | 78.10 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 19 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 285.64 |
| LogP ≤ 5 | 2.53 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
Analyze [4-chloro-6-(2,5-difluorophenyl)pyrimidin-5-yl] carbamate with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of [4-chloro-6-(2,5-difluorophenyl)pyrimidin-5-yl] carbamate?
The IUPAC name of [4-chloro-6-(2,5-difluorophenyl)pyrimidin-5-yl] carbamate (CID 175590753) is [4-chloro-6-(2,5-difluorophenyl)pyrimidin-5-yl] carbamate.
What is the SMILES notation for [4-chloro-6-(2,5-difluorophenyl)pyrimidin-5-yl] carbamate?
The canonical SMILES for [4-chloro-6-(2,5-difluorophenyl)pyrimidin-5-yl] carbamate is NC(=O)Oc1c(Cl)ncnc1-c1cc(F)ccc1F.
What is the InChIKey of [4-chloro-6-(2,5-difluorophenyl)pyrimidin-5-yl] carbamate?
The InChIKey is XPKBJYRFJHPDTQ-UHFFFAOYSA-N. The full InChI is InChI=1S/C11H6ClF2N3O2/c12-10-9(19-11(15)18)8(16-4-17-10)6-3-5(13)1-2-7(6)14/h1-4H,(H2,15,18).
What are the key properties of [4-chloro-6-(2,5-difluorophenyl)pyrimidin-5-yl] carbamate?
[4-chloro-6-(2,5-difluorophenyl)pyrimidin-5-yl] carbamate has a molecular weight of 285.64 g/mol, XLogP of 2.53, 2 rotatable bonds, 1 hydrogen bond donors, and 4 hydrogen bond acceptors.
Where does this data come from?
All data for [4-chloro-6-(2,5-difluorophenyl)pyrimidin-5-yl] carbamate is sourced from PubChem (CID 175590753), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).