About potassium;1-chloronaphthalene;tetrafluoroborate
potassium;1-chloronaphthalene;tetrafluoroborate (PubChem CID 175591005) has the molecular formula C10H7BClF4K
and a molecular weight of 288.52 g/mol. Its IUPAC name is potassium;1-chloronaphthalene;tetrafluoroborate.
Molecular Properties
| Compound Name | potassium;1-chloronaphthalene;tetrafluoroborate |
| PubChem CID | 175591005 |
| Molecular Formula | C10H7BClF4K |
| Molecular Weight | 288.52 g/mol |
| Exact Mass | 287.99 |
| IUPAC Name | potassium;1-chloronaphthalene;tetrafluoroborate |
| SMILES | Clc1cccc2ccccc12.F[B-](F)(F)F.[K+] |
| InChI | InChI=1S/C10H7Cl.BF4.K/c11-10-7-3-5-8-4-1-2-6-9(8)10;2-1(3,4)5;/h1-7H;;/q;-1;+1 |
| InChIKey | DSIWXEVQCYGRAJ-UHFFFAOYSA-N |
| XLogP | 1.80 |
| TPSA | 0.00 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | |
| Rotatable Bonds | |
| Heavy Atoms | 17 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 288.52 |
| LogP ≤ 5 | 1.80 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 0 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'heavy_metal', 'substructure': 'N/A'} |
|---|
Analyze potassium;1-chloronaphthalene;tetrafluoroborate with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of potassium;1-chloronaphthalene;tetrafluoroborate?
The IUPAC name of potassium;1-chloronaphthalene;tetrafluoroborate (CID 175591005) is potassium;1-chloronaphthalene;tetrafluoroborate.
What is the SMILES notation for potassium;1-chloronaphthalene;tetrafluoroborate?
The canonical SMILES for potassium;1-chloronaphthalene;tetrafluoroborate is Clc1cccc2ccccc12.F[B-](F)(F)F.[K+].
What is the InChIKey of potassium;1-chloronaphthalene;tetrafluoroborate?
The InChIKey is DSIWXEVQCYGRAJ-UHFFFAOYSA-N. The full InChI is InChI=1S/C10H7Cl.BF4.K/c11-10-7-3-5-8-4-1-2-6-9(8)10;2-1(3,4)5;/h1-7H;;/q;-1;+1.
What are the key properties of potassium;1-chloronaphthalene;tetrafluoroborate?
potassium;1-chloronaphthalene;tetrafluoroborate has a molecular weight of 288.52 g/mol, XLogP of 1.80, 0 rotatable bonds, 0 hydrogen bond donors, and 0 hydrogen bond acceptors.
Where does this data come from?
All data for potassium;1-chloronaphthalene;tetrafluoroborate is sourced from PubChem (CID 175591005), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).