C13H18N2O4 — CID 175591694
3-hydroxypropoxymethyl 5,6,7,8-tetrahydro-1,6-naphthyridine-2-carboxylate (PubChem CID 175591694) has the molecular formula C13H18N2O4 and a molecular weight of 266.30 g/mol. Its IUPAC name is 3-hydroxypropoxymethyl 5,6,7,8-tetrahydro-1,6-naphthyridine-2-carboxylate.
| Compound Name | 3-hydroxypropoxymethyl 5,6,7,8-tetrahydro-1,6-naphthyridine-2-carboxylate |
|---|---|
| PubChem CID | 175591694 |
| Molecular Formula | C13H18N2O4 |
| Molecular Weight | 266.30 g/mol |
| Exact Mass | 266.13 |
| IUPAC Name | 3-hydroxypropoxymethyl 5,6,7,8-tetrahydro-1,6-naphthyridine-2-carboxylate |
| SMILES | O=C(OCOCCCO)c1ccc2c(n1)CCNC2 |
| InChI | InChI=1S/C13H18N2O4/c16-6-1-7-18-9-19-13(17)12-3-2-10-8-14-5-4-11(10)15-12/h2-3,14,16H,1,4-9H2 |
| InChIKey | ZHVFEXSKRJFQMG-UHFFFAOYSA-N |
| XLogP | 0.24 |
| TPSA | 80.68 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 19 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 266.30 |
| LogP ≤ 5 | 0.24 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'het-C-het_not_in_ring', 'substructure': 'N/A'} |
|---|