C13H26O3Ti — CID 175591795
methanol;1-methyl-4,5,6,7-tetrahydro-1H-indene;titanium (PubChem CID 175591795) has the molecular formula C13H26O3Ti and a molecular weight of 278.21 g/mol. Its IUPAC name is methanol;1-methyl-4,5,6,7-tetrahydro-1H-indene;titanium.
| Compound Name | methanol;1-methyl-4,5,6,7-tetrahydro-1H-indene;titanium |
|---|---|
| PubChem CID | 175591795 |
| Molecular Formula | C13H26O3Ti |
| Molecular Weight | 278.21 g/mol |
| Exact Mass | 278.14 |
| IUPAC Name | methanol;1-methyl-4,5,6,7-tetrahydro-1H-indene;titanium |
| SMILES | CC1C=CC2=C1CCCC2.CO.CO.CO.[Ti] |
| InChI | InChI=1S/C10H14.3CH4O.Ti/c1-8-6-7-9-4-2-3-5-10(8)9;3*1-2;/h6-8H,2-5H2,1H3;3*2H,1H3; |
| InChIKey | LPKXJYXQPGTBLK-UHFFFAOYSA-N |
| XLogP | 1.89 |
| TPSA | 60.69 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | |
| Heavy Atoms | 17 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 278.21 |
| LogP ≤ 5 | 1.89 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 3 |