C22H36N4O5S2 — CID 175592107
N-hydroxyhexanamide;2-methoxy-5-[4-methyl-2-(pentylamino)-1,3-thiazol-5-yl]benzenesulfonamide (PubChem CID 175592107) has the molecular formula C22H36N4O5S2 and a molecular weight of 500.69 g/mol. Its IUPAC name is N-hydroxyhexanamide;2-methoxy-5-[4-methyl-2-(pentylamino)-1,3-thiazol-5-yl]benzenesulfonamide.
| Compound Name | N-hydroxyhexanamide;2-methoxy-5-[4-methyl-2-(pentylamino)-1,3-thiazol-5-yl]benzenesulfonamide |
|---|---|
| PubChem CID | 175592107 |
| Molecular Formula | C22H36N4O5S2 |
| Molecular Weight | 500.69 g/mol |
| Exact Mass | 500.21 |
| IUPAC Name | N-hydroxyhexanamide;2-methoxy-5-[4-methyl-2-(pentylamino)-1,3-thiazol-5-yl]benzenesulfonamide |
| SMILES | CCCCCC(=O)NO.CCCCCNc1nc(C)c(-c2ccc(OC)c(S(N)(=O)=O)c2)s1 |
| InChI | InChI=1S/C16H23N3O3S2.C6H13NO2/c1-4-5-6-9-18-16-19-11(2)15(23-16)12-7-8-13(22-3)14(10-12)24(17,20)21;1-2-3-4-5-6(8)7-9/h7-8,10H,4-6,9H2,1-3H3,(H,18,19)(H2,17,20,21);9H,2-5H2,1H3,(H,7,8) |
| InChIKey | AUOXATBVCHWOSX-UHFFFAOYSA-N |
| XLogP | 4.45 |
| TPSA | 143.64 Ų |
| H-Bond Donors | 4 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 12 |
| Heavy Atoms | 33 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 500.69 |
| LogP ≤ 5 | 4.45 |
| H-Bond Donors ≤ 5 | 4 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'hydroxamic_acid', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|