C32H23NO2 — CID 175592380
N,N-diphenylaniline;phenanthrene-1,2-dione (PubChem CID 175592380) has the molecular formula C32H23NO2 and a molecular weight of 453.54 g/mol. Its IUPAC name is N,N-diphenylaniline;phenanthrene-1,2-dione.
| Compound Name | N,N-diphenylaniline;phenanthrene-1,2-dione |
|---|---|
| PubChem CID | 175592380 |
| Molecular Formula | C32H23NO2 |
| Molecular Weight | 453.54 g/mol |
| Exact Mass | 453.17 |
| IUPAC Name | N,N-diphenylaniline;phenanthrene-1,2-dione |
| SMILES | O=C1C=Cc2c(ccc3ccccc23)C1=O.c1ccc(N(c2ccccc2)c2ccccc2)cc1 |
| InChI | InChI=1S/C18H15N.C14H8O2/c1-4-10-16(11-5-1)19(17-12-6-2-7-13-17)18-14-8-3-9-15-18;15-13-8-7-11-10-4-2-1-3-9(10)5-6-12(11)14(13)16/h1-15H;1-8H |
| InChIKey | JCFABUVOVRETHB-UHFFFAOYSA-N |
| XLogP | 7.77 |
| TPSA | 37.38 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 35 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 453.54 |
| LogP ≤ 5 | 7.77 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'imine_one_A(321)', 'substructure': 'N/A'}, {'alert_name': 'quinone_D(2)', 'substructure': 'N/A'}, {'alert_name': 'diketo_group', 'substructure': 'N/A'} |
|---|