C27H21F3N6O3 — CID 175592511
4-[4-amino-7-cyano-2-[4-(prop-2-enoylamino)phenyl]-1H-pyrrolo[3,2-c]pyridin-3-yl]-2-methoxy-N-(1,2,2-trifluoroethyl)benzamide (PubChem CID 175592511) has the molecular formula C27H21F3N6O3 and a molecular weight of 534.50 g/mol. Its IUPAC name is 4-[4-amino-7-cyano-2-[4-(prop-2-enoylamino)phenyl]-1H-pyrrolo[3,2-c]pyridin-3-yl]-2-methoxy-N-(1,2,2-trifluoroethyl)benzamide.
| Compound Name | 4-[4-amino-7-cyano-2-[4-(prop-2-enoylamino)phenyl]-1H-pyrrolo[3,2-c]pyridin-3-yl]-2-methoxy-N-(1,2,2-trifluoroethyl)benzamide |
|---|---|
| PubChem CID | 175592511 |
| Molecular Formula | C27H21F3N6O3 |
| Molecular Weight | 534.50 g/mol |
| Exact Mass | 534.16 |
| IUPAC Name | 4-[4-amino-7-cyano-2-[4-(prop-2-enoylamino)phenyl]-1H-pyrrolo[3,2-c]pyridin-3-yl]-2-methoxy-N-(1,2,2-trifluoroethyl)benzamide |
| SMILES | C=CC(=O)Nc1ccc(-c2[nH]c3c(C#N)cnc(N)c3c2-c2ccc(C(=O)NC(F)C(F)F)c(OC)c2)cc1 |
| InChI | InChI=1S/C27H21F3N6O3/c1-3-19(37)34-16-7-4-13(5-8-16)22-20(21-23(35-22)15(11-31)12-33-26(21)32)14-6-9-17(18(10-14)39-2)27(38)36-25(30)24(28)29/h3-10,12,24-25,35H,1H2,2H3,(H2,32,33)(H,34,37)(H,36,38) |
| InChIKey | SXBDBORXSPYOAA-UHFFFAOYSA-N |
| XLogP | 4.77 |
| TPSA | 145.92 Ų |
| H-Bond Donors | 4 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 39 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 534.50 |
| LogP ≤ 5 | 4.77 |
| H-Bond Donors ≤ 5 | 4 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'}, {'alert_name': 'N-C-halo', 'substructure': 'N/A'} |
|---|