C8F18 — CID 175593131
1,1,1,2,3,3,3-heptafluoro-2-(trifluoromethyl)propane;1,1,2,2,3,3,4,4-octafluorocyclobutane (PubChem CID 175593131) has the molecular formula C8F18 and a molecular weight of 438.05 g/mol. Its IUPAC name is 1,1,1,2,3,3,3-heptafluoro-2-(trifluoromethyl)propane;1,1,2,2,3,3,4,4-octafluorocyclobutane.
| Compound Name | 1,1,1,2,3,3,3-heptafluoro-2-(trifluoromethyl)propane;1,1,2,2,3,3,4,4-octafluorocyclobutane |
|---|---|
| PubChem CID | 175593131 |
| Molecular Formula | C8F18 |
| Molecular Weight | 438.05 g/mol |
| Exact Mass | 437.97 |
| IUPAC Name | 1,1,1,2,3,3,3-heptafluoro-2-(trifluoromethyl)propane;1,1,2,2,3,3,4,4-octafluorocyclobutane |
| SMILES | FC(F)(F)C(F)(C(F)(F)F)C(F)(F)F.FC1(F)C(F)(F)C(F)(F)C1(F)F |
| InChI | InChI=1S/C4F10.C4F8/c5-1(2(6,7)8,3(9,10)11)4(12,13)14;5-1(6)2(7,8)4(11,12)3(1,9)10 |
| InChIKey | VMDMCOSETBUADE-UHFFFAOYSA-N |
| XLogP | 5.92 |
| TPSA | 0.00 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | |
| Rotatable Bonds | |
| Heavy Atoms | 26 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 438.05 |
| LogP ≤ 5 | 5.92 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 0 |
| Structural Alerts | {'alert_name': 'Perfluorinated_chain', 'substructure': 'N/A'} |
|---|