C55H69N3 — CID 175593774
1,3-bis[4-tert-butyl-2,6-bis[(1R)-1-ethylcyclohexa-2,4-dien-1-yl]phenyl]imidazol-2-imine (PubChem CID 175593774) has the molecular formula C55H69N3 and a molecular weight of 772.18 g/mol. Its IUPAC name is 1,3-bis[4-tert-butyl-2,6-bis[(1R)-1-ethylcyclohexa-2,4-dien-1-yl]phenyl]imidazol-2-imine.
| Compound Name | 1,3-bis[4-tert-butyl-2,6-bis[(1R)-1-ethylcyclohexa-2,4-dien-1-yl]phenyl]imidazol-2-imine |
|---|---|
| PubChem CID | 175593774 |
| Molecular Formula | C55H69N3 |
| Molecular Weight | 772.18 g/mol |
| Exact Mass | 771.55 |
| IUPAC Name | 1,3-bis[4-tert-butyl-2,6-bis[(1R)-1-ethylcyclohexa-2,4-dien-1-yl]phenyl]imidazol-2-imine |
| SMILES | [H]N=c1n(-c2c([C@@]3(CC)C=CC=CC3)cc(C(C)(C)C)cc2[C@@]2(CC)C=CC=CC2)ccn1-c1c([C@@]2(CC)C=CC=CC2)cc(C(C)(C)C)cc1[C@@]1(CC)C=CC=CC1 |
| InChI | InChI=1S/C55H69N3/c1-11-52(27-19-15-20-28-52)43-37-41(50(5,6)7)38-44(53(12-2)29-21-16-22-30-53)47(43)57-35-36-58(49(57)56)48-45(54(13-3)31-23-17-24-32-54)39-42(51(8,9)10)40-46(48)55(14-4)33-25-18-26-34-55/h15-27,29,31,33,35-40,56H,11-14,28,30,32,34H2,1-10H3/t52-,53-,54-,55-/m0/s1 |
| InChIKey | OQUPOBFLUJZFGX-RWNJCICYSA-N |
| XLogP | 14.00 |
| TPSA | 33.71 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 10 |
| Heavy Atoms | 58 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 772.18 |
| LogP ≤ 5 | 14.00 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |