C24H27ClFN5O3S — CID 175595723
(3R)-5-[(4-chlorophenyl)methyl]-8-fluoro-7-[5-(4-methylpiperidin-4-yl)-1,3,4-oxadiazol-2-yl]-1,1-dioxo-3,4-dihydro-2H-1λ6,5-benzothiazepin-3-amine (PubChem CID 175595723) has the molecular formula C24H27ClFN5O3S and a molecular weight of 520.03 g/mol. Its IUPAC name is (3R)-5-[(4-chlorophenyl)methyl]-8-fluoro-7-[5-(4-methylpiperidin-4-yl)-1,3,4-oxadiazol-2-yl]-1,1-dioxo-3,4-dihydro-2H-1λ6,5-benzothiazepin-3-amine.
| Compound Name | (3R)-5-[(4-chlorophenyl)methyl]-8-fluoro-7-[5-(4-methylpiperidin-4-yl)-1,3,4-oxadiazol-2-yl]-1,1-dioxo-3,4-dihydro-2H-1λ6,5-benzothiazepin-3-amine |
|---|---|
| PubChem CID | 175595723 |
| Molecular Formula | C24H27ClFN5O3S |
| Molecular Weight | 520.03 g/mol |
| Exact Mass | 519.15 |
| IUPAC Name | (3R)-5-[(4-chlorophenyl)methyl]-8-fluoro-7-[5-(4-methylpiperidin-4-yl)-1,3,4-oxadiazol-2-yl]-1,1-dioxo-3,4-dihydro-2H-1λ6,5-benzothiazepin-3-amine |
| SMILES | CC1(c2nnc(-c3cc4c(cc3F)S(=O)(=O)C[C@H](N)CN4Cc3ccc(Cl)cc3)o2)CCNCC1 |
| InChI | InChI=1S/C24H27ClFN5O3S/c1-24(6-8-28-9-7-24)23-30-29-22(34-23)18-10-20-21(11-19(18)26)35(32,33)14-17(27)13-31(20)12-15-2-4-16(25)5-3-15/h2-5,10-11,17,28H,6-9,12-14,27H2,1H3/t17-/m1/s1 |
| InChIKey | HZBUFULWGXGCJN-QGZVFWFLSA-N |
| XLogP | 3.29 |
| TPSA | 114.35 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 35 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 520.03 |
| LogP ≤ 5 | 3.29 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 8 |