C21H23ClFN5O3S — CID 175595815
(3R)-7-(5-tert-butyl-1,3,4-oxadiazol-2-yl)-5-[(6-chloro-3-pyridinyl)methyl]-8-fluoro-1,1-dioxo-3,4-dihydro-2H-1λ6,5-benzothiazepin-3-amine (PubChem CID 175595815) has the molecular formula C21H23ClFN5O3S and a molecular weight of 479.97 g/mol. Its IUPAC name is (3R)-7-(5-tert-butyl-1,3,4-oxadiazol-2-yl)-5-[(6-chloro-3-pyridinyl)methyl]-8-fluoro-1,1-dioxo-3,4-dihydro-2H-1λ6,5-benzothiazepin-3-amine.
| Compound Name | (3R)-7-(5-tert-butyl-1,3,4-oxadiazol-2-yl)-5-[(6-chloro-3-pyridinyl)methyl]-8-fluoro-1,1-dioxo-3,4-dihydro-2H-1λ6,5-benzothiazepin-3-amine |
|---|---|
| PubChem CID | 175595815 |
| Molecular Formula | C21H23ClFN5O3S |
| Molecular Weight | 479.97 g/mol |
| Exact Mass | 479.12 |
| IUPAC Name | (3R)-7-(5-tert-butyl-1,3,4-oxadiazol-2-yl)-5-[(6-chloro-3-pyridinyl)methyl]-8-fluoro-1,1-dioxo-3,4-dihydro-2H-1λ6,5-benzothiazepin-3-amine |
| SMILES | CC(C)(C)c1nnc(-c2cc3c(cc2F)S(=O)(=O)C[C@H](N)CN3Cc2ccc(Cl)nc2)o1 |
| InChI | InChI=1S/C21H23ClFN5O3S/c1-21(2,3)20-27-26-19(31-20)14-6-16-17(7-15(14)23)32(29,30)11-13(24)10-28(16)9-12-4-5-18(22)25-8-12/h4-8,13H,9-11,24H2,1-3H3/t13-/m1/s1 |
| InChIKey | UUTSIJWEIWIPOO-CYBMUJFWSA-N |
| XLogP | 3.34 |
| TPSA | 115.21 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 32 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 479.97 |
| LogP ≤ 5 | 3.34 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': '2-halo_pyridine', 'substructure': 'N/A'} |
|---|