C22H24ClFN4O4S — CID 175596050
[1-[(3R)-5-[(4-chlorophenyl)methyl]-8-fluoro-7-(hydrazinecarbonyl)-4-oxo-2,3-dihydro-1,5-benzothiazepin-3-yl]-2-methylpropan-2-yl]carbamic acid (PubChem CID 175596050) has the molecular formula C22H24ClFN4O4S and a molecular weight of 494.98 g/mol. Its IUPAC name is [1-[(3R)-5-[(4-chlorophenyl)methyl]-8-fluoro-7-(hydrazinecarbonyl)-4-oxo-2,3-dihydro-1,5-benzothiazepin-3-yl]-2-methylpropan-2-yl]carbamic acid.
| Compound Name | [1-[(3R)-5-[(4-chlorophenyl)methyl]-8-fluoro-7-(hydrazinecarbonyl)-4-oxo-2,3-dihydro-1,5-benzothiazepin-3-yl]-2-methylpropan-2-yl]carbamic acid |
|---|---|
| PubChem CID | 175596050 |
| Molecular Formula | C22H24ClFN4O4S |
| Molecular Weight | 494.98 g/mol |
| Exact Mass | 494.12 |
| IUPAC Name | [1-[(3R)-5-[(4-chlorophenyl)methyl]-8-fluoro-7-(hydrazinecarbonyl)-4-oxo-2,3-dihydro-1,5-benzothiazepin-3-yl]-2-methylpropan-2-yl]carbamic acid |
| SMILES | CC(C)(C[C@H]1CSc2cc(F)c(C(=O)NN)cc2N(Cc2ccc(Cl)cc2)C1=O)NC(=O)O |
| InChI | InChI=1S/C22H24ClFN4O4S/c1-22(2,26-21(31)32)9-13-11-33-18-8-16(24)15(19(29)27-25)7-17(18)28(20(13)30)10-12-3-5-14(23)6-4-12/h3-8,13,26H,9-11,25H2,1-2H3,(H,27,29)(H,31,32)/t13-/m0/s1 |
| InChIKey | XIFJKSKWDGZJEQ-ZDUSSCGKSA-N |
| XLogP | 3.77 |
| TPSA | 124.76 Ų |
| H-Bond Donors | 4 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 33 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 494.98 |
| LogP ≤ 5 | 3.77 |
| H-Bond Donors ≤ 5 | 4 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'acyl_hydrazine', 'substructure': 'N/A'}, {'alert_name': 'hydrazine', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|