C17H16ClF3O6S — CID 175596138
2-(2-chloro-3-methyl-4-methylsulfonylbenzoyl)cyclohexane-1,3-dione;2,2,3-trifluorooxirane (PubChem CID 175596138) has the molecular formula C17H16ClF3O6S and a molecular weight of 440.82 g/mol. Its IUPAC name is 2-(2-chloro-3-methyl-4-methylsulfonylbenzoyl)cyclohexane-1,3-dione;2,2,3-trifluorooxirane.
| Compound Name | 2-(2-chloro-3-methyl-4-methylsulfonylbenzoyl)cyclohexane-1,3-dione;2,2,3-trifluorooxirane |
|---|---|
| PubChem CID | 175596138 |
| Molecular Formula | C17H16ClF3O6S |
| Molecular Weight | 440.82 g/mol |
| Exact Mass | 440.03 |
| IUPAC Name | 2-(2-chloro-3-methyl-4-methylsulfonylbenzoyl)cyclohexane-1,3-dione;2,2,3-trifluorooxirane |
| SMILES | Cc1c(S(C)(=O)=O)ccc(C(=O)C2C(=O)CCCC2=O)c1Cl.FC1OC1(F)F |
| InChI | InChI=1S/C15H15ClO5S.C2HF3O/c1-8-12(22(2,20)21)7-6-9(14(8)16)15(19)13-10(17)4-3-5-11(13)18;3-1-2(4,5)6-1/h6-7,13H,3-5H2,1-2H3;1H |
| InChIKey | TXTKXJFNGYBAPQ-UHFFFAOYSA-N |
| XLogP | 3.08 |
| TPSA | 97.88 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 28 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 440.82 |
| LogP ≤ 5 | 3.08 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'beta-keto/anhydride', 'substructure': 'N/A'}, {'alert_name': 'Three-membered_heterocycle', 'substructure': 'N/A'} |
|---|