About 2-[2,4-diethyl-3,5-bis(4-fluorophenyl)-6-methylphenyl]iminoacenaphthylen-1-one
2-[2,4-diethyl-3,5-bis(4-fluorophenyl)-6-methylphenyl]iminoacenaphthylen-1-one (PubChem CID 175596733) has the molecular formula C35H27F2NO
and a molecular weight of 515.60 g/mol. Its IUPAC name is 2-[2,4-diethyl-3,5-bis(4-fluorophenyl)-6-methylphenyl]iminoacenaphthylen-1-one.
Molecular Properties
| Compound Name | 2-[2,4-diethyl-3,5-bis(4-fluorophenyl)-6-methylphenyl]iminoacenaphthylen-1-one |
| PubChem CID | 175596733 |
| Molecular Formula | C35H27F2NO |
| Molecular Weight | 515.60 g/mol |
| Exact Mass | 515.21 |
| IUPAC Name | 2-[2,4-diethyl-3,5-bis(4-fluorophenyl)-6-methylphenyl]iminoacenaphthylen-1-one |
| SMILES | CCc1c(/N=C2/C(=O)c3cccc4cccc2c34)c(C)c(-c2ccc(F)cc2)c(CC)c1-c1ccc(F)cc1 |
| InChI | InChI=1S/C35H27F2NO/c1-4-26-30(22-12-16-24(36)17-13-22)20(3)33(27(5-2)31(26)23-14-18-25(37)19-15-23)38-34-28-10-6-8-21-9-7-11-29(32(21)28)35(34)39/h6-19H,4-5H2,1-3H3/b38-34+ |
| InChIKey | YIYCEYRWZDLAFZ-XCWGLRIOSA-N |
| XLogP | 9.20 |
| TPSA | 29.43 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 39 |
| Complexity | — |
Lipinski Rule of Five
2 violations
| Rule | Value |
| MW ≤ 500 | 515.60 |
| LogP ≤ 5 | 9.20 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'imine_one_A(321)', 'substructure': 'N/A'}, {'alert_name': 'imine_1', 'substructure': 'N/A'} |
|---|
Analyze 2-[2,4-diethyl-3,5-bis(4-fluorophenyl)-6-methylphenyl]iminoacenaphthylen-1-one with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 2-[2,4-diethyl-3,5-bis(4-fluorophenyl)-6-methylphenyl]iminoacenaphthylen-1-one?
The IUPAC name of 2-[2,4-diethyl-3,5-bis(4-fluorophenyl)-6-methylphenyl]iminoacenaphthylen-1-one (CID 175596733) is 2-[2,4-diethyl-3,5-bis(4-fluorophenyl)-6-methylphenyl]iminoacenaphthylen-1-one.
What is the SMILES notation for 2-[2,4-diethyl-3,5-bis(4-fluorophenyl)-6-methylphenyl]iminoacenaphthylen-1-one?
The canonical SMILES for 2-[2,4-diethyl-3,5-bis(4-fluorophenyl)-6-methylphenyl]iminoacenaphthylen-1-one is CCc1c(/N=C2/C(=O)c3cccc4cccc2c34)c(C)c(-c2ccc(F)cc2)c(CC)c1-c1ccc(F)cc1.
What is the InChIKey of 2-[2,4-diethyl-3,5-bis(4-fluorophenyl)-6-methylphenyl]iminoacenaphthylen-1-one?
The InChIKey is YIYCEYRWZDLAFZ-XCWGLRIOSA-N. The full InChI is InChI=1S/C35H27F2NO/c1-4-26-30(22-12-16-24(36)17-13-22)20(3)33(27(5-2)31(26)23-14-18-25(37)19-15-23)38-34-28-10-6-8-21-9-7-11-29(32(21)28)35(34)39/h6-19H,4-5H2,1-3H3/b38-34+.
What are the key properties of 2-[2,4-diethyl-3,5-bis(4-fluorophenyl)-6-methylphenyl]iminoacenaphthylen-1-one?
2-[2,4-diethyl-3,5-bis(4-fluorophenyl)-6-methylphenyl]iminoacenaphthylen-1-one has a molecular weight of 515.60 g/mol, XLogP of 9.20, 5 rotatable bonds, 0 hydrogen bond donors, and 2 hydrogen bond acceptors.
Where does this data come from?
All data for 2-[2,4-diethyl-3,5-bis(4-fluorophenyl)-6-methylphenyl]iminoacenaphthylen-1-one is sourced from PubChem (CID 175596733), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).