About sodium;bicyclo[3.1.0]hexan-3-amine;2-(tert-butylamino)ethanesulfonate
sodium;bicyclo[3.1.0]hexan-3-amine;2-(tert-butylamino)ethanesulfonate (PubChem CID 175597006) has the molecular formula C12H25N2NaO3S
and a molecular weight of 300.40 g/mol. Its IUPAC name is sodium;bicyclo[3.1.0]hexan-3-amine;2-(tert-butylamino)ethanesulfonate.
Molecular Properties
| Compound Name | sodium;bicyclo[3.1.0]hexan-3-amine;2-(tert-butylamino)ethanesulfonate |
| PubChem CID | 175597006 |
| Molecular Formula | C12H25N2NaO3S |
| Molecular Weight | 300.40 g/mol |
| Exact Mass | 300.15 |
| IUPAC Name | sodium;bicyclo[3.1.0]hexan-3-amine;2-(tert-butylamino)ethanesulfonate |
| SMILES | CC(C)(C)NCCS(=O)(=O)[O-].NC1CC2CC2C1.[Na+] |
| InChI | InChI=1S/C6H15NO3S.C6H11N.Na/c1-6(2,3)7-4-5-11(8,9)10;7-6-2-4-1-5(4)3-6;/h7H,4-5H2,1-3H3,(H,8,9,10);4-6H,1-3,7H2;/q;;+1/p-1 |
| InChIKey | YENNMYMUFMOSEO-UHFFFAOYSA-M |
| XLogP | -2.33 |
| TPSA | 95.25 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 19 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 300.40 |
| LogP ≤ 5 | -2.33 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'Sulfonic_acid_2', 'substructure': 'N/A'} |
|---|
Analyze sodium;bicyclo[3.1.0]hexan-3-amine;2-(tert-butylamino)ethanesulfonate with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of sodium;bicyclo[3.1.0]hexan-3-amine;2-(tert-butylamino)ethanesulfonate?
The IUPAC name of sodium;bicyclo[3.1.0]hexan-3-amine;2-(tert-butylamino)ethanesulfonate (CID 175597006) is sodium;bicyclo[3.1.0]hexan-3-amine;2-(tert-butylamino)ethanesulfonate.
What is the SMILES notation for sodium;bicyclo[3.1.0]hexan-3-amine;2-(tert-butylamino)ethanesulfonate?
The canonical SMILES for sodium;bicyclo[3.1.0]hexan-3-amine;2-(tert-butylamino)ethanesulfonate is CC(C)(C)NCCS(=O)(=O)[O-].NC1CC2CC2C1.[Na+].
What is the InChIKey of sodium;bicyclo[3.1.0]hexan-3-amine;2-(tert-butylamino)ethanesulfonate?
The InChIKey is YENNMYMUFMOSEO-UHFFFAOYSA-M. The full InChI is InChI=1S/C6H15NO3S.C6H11N.Na/c1-6(2,3)7-4-5-11(8,9)10;7-6-2-4-1-5(4)3-6;/h7H,4-5H2,1-3H3,(H,8,9,10);4-6H,1-3,7H2;/q;;+1/p-1.
What are the key properties of sodium;bicyclo[3.1.0]hexan-3-amine;2-(tert-butylamino)ethanesulfonate?
sodium;bicyclo[3.1.0]hexan-3-amine;2-(tert-butylamino)ethanesulfonate has a molecular weight of 300.40 g/mol, XLogP of -2.33, 3 rotatable bonds, 2 hydrogen bond donors, and 5 hydrogen bond acceptors.
Where does this data come from?
All data for sodium;bicyclo[3.1.0]hexan-3-amine;2-(tert-butylamino)ethanesulfonate is sourced from PubChem (CID 175597006), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).