About N-ethyl-N-methyl-2-oxo-1,3,2λ5-dioxaphosphinan-2-amine
N-ethyl-N-methyl-2-oxo-1,3,2λ5-dioxaphosphinan-2-amine (PubChem CID 175597420) has the molecular formula C6H14NO3P
and a molecular weight of 179.16 g/mol. Its IUPAC name is N-ethyl-N-methyl-2-oxo-1,3,2λ5-dioxaphosphinan-2-amine.
Molecular Properties
| Compound Name | N-ethyl-N-methyl-2-oxo-1,3,2λ5-dioxaphosphinan-2-amine |
| PubChem CID | 175597420 |
| Molecular Formula | C6H14NO3P |
| Molecular Weight | 179.16 g/mol |
| Exact Mass | 179.07 |
| IUPAC Name | N-ethyl-N-methyl-2-oxo-1,3,2λ5-dioxaphosphinan-2-amine |
| SMILES | CCN(C)P1(=O)OCCCO1 |
| InChI | InChI=1S/C6H14NO3P/c1-3-7(2)11(8)9-5-4-6-10-11/h3-6H2,1-2H3 |
| InChIKey | LPPDNJKQQYHFNX-UHFFFAOYSA-N |
| XLogP | 1.48 |
| TPSA | 38.77 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 11 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 179.16 |
| LogP ≤ 5 | 1.48 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'phosphor', 'substructure': 'N/A'} |
|---|
Analyze N-ethyl-N-methyl-2-oxo-1,3,2λ5-dioxaphosphinan-2-amine with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of N-ethyl-N-methyl-2-oxo-1,3,2λ5-dioxaphosphinan-2-amine?
The IUPAC name of N-ethyl-N-methyl-2-oxo-1,3,2λ5-dioxaphosphinan-2-amine (CID 175597420) is N-ethyl-N-methyl-2-oxo-1,3,2λ5-dioxaphosphinan-2-amine.
What is the SMILES notation for N-ethyl-N-methyl-2-oxo-1,3,2λ5-dioxaphosphinan-2-amine?
The canonical SMILES for N-ethyl-N-methyl-2-oxo-1,3,2λ5-dioxaphosphinan-2-amine is CCN(C)P1(=O)OCCCO1.
What is the InChIKey of N-ethyl-N-methyl-2-oxo-1,3,2λ5-dioxaphosphinan-2-amine?
The InChIKey is LPPDNJKQQYHFNX-UHFFFAOYSA-N. The full InChI is InChI=1S/C6H14NO3P/c1-3-7(2)11(8)9-5-4-6-10-11/h3-6H2,1-2H3.
What are the key properties of N-ethyl-N-methyl-2-oxo-1,3,2λ5-dioxaphosphinan-2-amine?
N-ethyl-N-methyl-2-oxo-1,3,2λ5-dioxaphosphinan-2-amine has a molecular weight of 179.16 g/mol, XLogP of 1.48, 2 rotatable bonds, 0 hydrogen bond donors, and 3 hydrogen bond acceptors.
Where does this data come from?
All data for N-ethyl-N-methyl-2-oxo-1,3,2λ5-dioxaphosphinan-2-amine is sourced from PubChem (CID 175597420), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).