C48H36N4O4 — CID 175597526
2,3,5,7-tetramethoxy-8,10,12,13-tetraphenylporphyrin (PubChem CID 175597526) has the molecular formula C48H36N4O4 and a molecular weight of 732.84 g/mol. Its IUPAC name is 2,3,5,7-tetramethoxy-8,10,12,13-tetraphenylporphyrin.
| Compound Name | 2,3,5,7-tetramethoxy-8,10,12,13-tetraphenylporphyrin |
|---|---|
| PubChem CID | 175597526 |
| Molecular Formula | C48H36N4O4 |
| Molecular Weight | 732.84 g/mol |
| Exact Mass | 732.27 |
| IUPAC Name | 2,3,5,7-tetramethoxy-8,10,12,13-tetraphenylporphyrin |
| SMILES | COC1=C(OC)/C2=C/C3=N/C(=C\C4=N/C(=C(/c5ccccc5)C5=N/C(=C(/OC)C1=N2)C(OC)=C5c1ccccc1)C(c1ccccc1)=C4c1ccccc1)C=C3 |
| InChI | InChI=1S/C48H36N4O4/c1-53-45-36-28-34-26-25-33(49-34)27-35-37(29-17-9-5-10-18-29)38(30-19-11-6-12-20-30)41(50-35)39(31-21-13-7-14-22-31)42-40(32-23-15-8-16-24-32)46(54-2)43(52-42)47(55-3)44(51-36)48(45)56-4/h5-28H,1-4H3/b33-27-,34-28-,35-27-,36-28-,41-39-,42-39-,47-43+,47-44+ |
| InChIKey | XRNOADHABAXWCW-ZYDCHEEPSA-N |
| XLogP | 9.58 |
| TPSA | 86.36 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 56 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 732.84 |
| LogP ≤ 5 | 9.58 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'stilbene', 'substructure': 'N/A'} |
|---|