C20H33BN2O2 — CID 175597630
N,N-dimethyl-1-[3-(2-methylpyrrolidin-1-yl)-5-(4,4,5,5-tetramethyl-1,3,2-dioxaborolan-2-yl)phenyl]methanamine (PubChem CID 175597630) has the molecular formula C20H33BN2O2 and a molecular weight of 344.31 g/mol. Its IUPAC name is N,N-dimethyl-1-[3-(2-methylpyrrolidin-1-yl)-5-(4,4,5,5-tetramethyl-1,3,2-dioxaborolan-2-yl)phenyl]methanamine.
| Compound Name | N,N-dimethyl-1-[3-(2-methylpyrrolidin-1-yl)-5-(4,4,5,5-tetramethyl-1,3,2-dioxaborolan-2-yl)phenyl]methanamine |
|---|---|
| PubChem CID | 175597630 |
| Molecular Formula | C20H33BN2O2 |
| Molecular Weight | 344.31 g/mol |
| Exact Mass | 344.26 |
| IUPAC Name | N,N-dimethyl-1-[3-(2-methylpyrrolidin-1-yl)-5-(4,4,5,5-tetramethyl-1,3,2-dioxaborolan-2-yl)phenyl]methanamine |
| SMILES | CC1CCCN1c1cc(CN(C)C)cc(B2OC(C)(C)C(C)(C)O2)c1 |
| InChI | InChI=1S/C20H33BN2O2/c1-15-9-8-10-23(15)18-12-16(14-22(6)7)11-17(13-18)21-24-19(2,3)20(4,5)25-21/h11-13,15H,8-10,14H2,1-7H3 |
| InChIKey | ICZOIENBQYCTLZ-UHFFFAOYSA-N |
| XLogP | 3.04 |
| TPSA | 24.94 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 25 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 344.31 |
| LogP ≤ 5 | 3.04 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'heavy_metal', 'substructure': 'N/A'} |
|---|