About (2R)-2-[2-[2-oxo-5-(trifluoromethyl)-1H-pyridin-3-yl]ethenyl]piperazine-1,4-dicarboxylic acid
(2R)-2-[2-[2-oxo-5-(trifluoromethyl)-1H-pyridin-3-yl]ethenyl]piperazine-1,4-dicarboxylic acid (PubChem CID 175598166) has the molecular formula C14H14F3N3O5
and a molecular weight of 361.28 g/mol. Its IUPAC name is (2R)-2-[2-[2-oxo-5-(trifluoromethyl)-1H-pyridin-3-yl]ethenyl]piperazine-1,4-dicarboxylic acid.
Molecular Properties
| Compound Name | (2R)-2-[2-[2-oxo-5-(trifluoromethyl)-1H-pyridin-3-yl]ethenyl]piperazine-1,4-dicarboxylic acid |
| PubChem CID | 175598166 |
| Molecular Formula | C14H14F3N3O5 |
| Molecular Weight | 361.28 g/mol |
| Exact Mass | 361.09 |
| IUPAC Name | (2R)-2-[2-[2-oxo-5-(trifluoromethyl)-1H-pyridin-3-yl]ethenyl]piperazine-1,4-dicarboxylic acid |
| SMILES | O=C(O)N1CCN(C(=O)O)[C@H](C=Cc2cc(C(F)(F)F)c[nH]c2=O)C1 |
| InChI | InChI=1S/C14H14F3N3O5/c15-14(16,17)9-5-8(11(21)18-6-9)1-2-10-7-19(12(22)23)3-4-20(10)13(24)25/h1-2,5-6,10H,3-4,7H2,(H,18,21)(H,22,23)(H,24,25)/t10-/m1/s1 |
| InChIKey | NEWISRDJHDWCDG-SNVBAGLBSA-N |
| XLogP | 1.75 |
| TPSA | 113.94 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 25 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 361.28 |
| LogP ≤ 5 | 1.75 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 3 |
Analyze (2R)-2-[2-[2-oxo-5-(trifluoromethyl)-1H-pyridin-3-yl]ethenyl]piperazine-1,4-dicarboxylic acid with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of (2R)-2-[2-[2-oxo-5-(trifluoromethyl)-1H-pyridin-3-yl]ethenyl]piperazine-1,4-dicarboxylic acid?
The IUPAC name of (2R)-2-[2-[2-oxo-5-(trifluoromethyl)-1H-pyridin-3-yl]ethenyl]piperazine-1,4-dicarboxylic acid (CID 175598166) is (2R)-2-[2-[2-oxo-5-(trifluoromethyl)-1H-pyridin-3-yl]ethenyl]piperazine-1,4-dicarboxylic acid.
What is the SMILES notation for (2R)-2-[2-[2-oxo-5-(trifluoromethyl)-1H-pyridin-3-yl]ethenyl]piperazine-1,4-dicarboxylic acid?
The canonical SMILES for (2R)-2-[2-[2-oxo-5-(trifluoromethyl)-1H-pyridin-3-yl]ethenyl]piperazine-1,4-dicarboxylic acid is O=C(O)N1CCN(C(=O)O)[C@H](C=Cc2cc(C(F)(F)F)c[nH]c2=O)C1.
What is the InChIKey of (2R)-2-[2-[2-oxo-5-(trifluoromethyl)-1H-pyridin-3-yl]ethenyl]piperazine-1,4-dicarboxylic acid?
The InChIKey is NEWISRDJHDWCDG-SNVBAGLBSA-N. The full InChI is InChI=1S/C14H14F3N3O5/c15-14(16,17)9-5-8(11(21)18-6-9)1-2-10-7-19(12(22)23)3-4-20(10)13(24)25/h1-2,5-6,10H,3-4,7H2,(H,18,21)(H,22,23)(H,24,25)/t10-/m1/s1.
What are the key properties of (2R)-2-[2-[2-oxo-5-(trifluoromethyl)-1H-pyridin-3-yl]ethenyl]piperazine-1,4-dicarboxylic acid?
(2R)-2-[2-[2-oxo-5-(trifluoromethyl)-1H-pyridin-3-yl]ethenyl]piperazine-1,4-dicarboxylic acid has a molecular weight of 361.28 g/mol, XLogP of 1.75, 2 rotatable bonds, 3 hydrogen bond donors, and 3 hydrogen bond acceptors.
Where does this data come from?
All data for (2R)-2-[2-[2-oxo-5-(trifluoromethyl)-1H-pyridin-3-yl]ethenyl]piperazine-1,4-dicarboxylic acid is sourced from PubChem (CID 175598166), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).