C15H16O7 — CID 175599646
4-methyl-3,4-dihydro-2,5-benzodioxocine-1,6-dione;4-methyl-1,3-dioxolan-2-one (PubChem CID 175599646) has the molecular formula C15H16O7 and a molecular weight of 308.29 g/mol. Its IUPAC name is 4-methyl-3,4-dihydro-2,5-benzodioxocine-1,6-dione;4-methyl-1,3-dioxolan-2-one.
| Compound Name | 4-methyl-3,4-dihydro-2,5-benzodioxocine-1,6-dione;4-methyl-1,3-dioxolan-2-one |
|---|---|
| PubChem CID | 175599646 |
| Molecular Formula | C15H16O7 |
| Molecular Weight | 308.29 g/mol |
| Exact Mass | 308.09 |
| IUPAC Name | 4-methyl-3,4-dihydro-2,5-benzodioxocine-1,6-dione;4-methyl-1,3-dioxolan-2-one |
| SMILES | CC1COC(=O)O1.CC1COC(=O)c2ccccc2C(=O)O1 |
| InChI | InChI=1S/C11H10O4.C4H6O3/c1-7-6-14-10(12)8-4-2-3-5-9(8)11(13)15-7;1-3-2-6-4(5)7-3/h2-5,7H,6H2,1H3;3H,2H2,1H3 |
| InChIKey | GGSWQYREPAPVGD-UHFFFAOYSA-N |
| XLogP | 1.94 |
| TPSA | 88.13 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | |
| Heavy Atoms | 22 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 308.29 |
| LogP ≤ 5 | 1.94 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': '>_2_ester_groups', 'substructure': 'N/A'} |
|---|