C22H29FN2O6 — CID 175599773
diethyl 7-fluoro-1-[1-[(2-methylpropan-2-yl)oxycarbonylamino]propan-2-yl]indole-2,6-dicarboxylate (PubChem CID 175599773) has the molecular formula C22H29FN2O6 and a molecular weight of 436.48 g/mol. Its IUPAC name is diethyl 7-fluoro-1-[1-[(2-methylpropan-2-yl)oxycarbonylamino]propan-2-yl]indole-2,6-dicarboxylate.
| Compound Name | diethyl 7-fluoro-1-[1-[(2-methylpropan-2-yl)oxycarbonylamino]propan-2-yl]indole-2,6-dicarboxylate |
|---|---|
| PubChem CID | 175599773 |
| Molecular Formula | C22H29FN2O6 |
| Molecular Weight | 436.48 g/mol |
| Exact Mass | 436.20 |
| IUPAC Name | diethyl 7-fluoro-1-[1-[(2-methylpropan-2-yl)oxycarbonylamino]propan-2-yl]indole-2,6-dicarboxylate |
| SMILES | CCOC(=O)c1ccc2cc(C(=O)OCC)n(C(C)CNC(=O)OC(C)(C)C)c2c1F |
| InChI | InChI=1S/C22H29FN2O6/c1-7-29-19(26)15-10-9-14-11-16(20(27)30-8-2)25(18(14)17(15)23)13(3)12-24-21(28)31-22(4,5)6/h9-11,13H,7-8,12H2,1-6H3,(H,24,28) |
| InChIKey | JJXMKJXJTCSGGD-UHFFFAOYSA-N |
| XLogP | 4.22 |
| TPSA | 95.86 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 31 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 436.48 |
| LogP ≤ 5 | 4.22 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': '>_2_ester_groups', 'substructure': 'N/A'} |
|---|