C13H18ClNO3 — CID 175599870
2-chloro-5-methoxy-4-(2,4,4,5-tetramethyl-1,3-dioxolan-2-yl)pyridine (PubChem CID 175599870) has the molecular formula C13H18ClNO3 and a molecular weight of 271.74 g/mol. Its IUPAC name is 2-chloro-5-methoxy-4-(2,4,4,5-tetramethyl-1,3-dioxolan-2-yl)pyridine.
| Compound Name | 2-chloro-5-methoxy-4-(2,4,4,5-tetramethyl-1,3-dioxolan-2-yl)pyridine |
|---|---|
| PubChem CID | 175599870 |
| Molecular Formula | C13H18ClNO3 |
| Molecular Weight | 271.74 g/mol |
| Exact Mass | 271.10 |
| IUPAC Name | 2-chloro-5-methoxy-4-(2,4,4,5-tetramethyl-1,3-dioxolan-2-yl)pyridine |
| SMILES | COc1cnc(Cl)cc1C1(C)OC(C)C(C)(C)O1 |
| InChI | InChI=1S/C13H18ClNO3/c1-8-12(2,3)18-13(4,17-8)9-6-11(14)15-7-10(9)16-5/h6-8H,1-5H3 |
| InChIKey | FKCNELDKWFRICL-UHFFFAOYSA-N |
| XLogP | 3.13 |
| TPSA | 40.58 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 18 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 271.74 |
| LogP ≤ 5 | 3.13 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': '2-halo_pyridine', 'substructure': 'N/A'} |
|---|