About 1-isocyanato-1,3,5-tris(isocyanatomethyl)cyclohexane
1-isocyanato-1,3,5-tris(isocyanatomethyl)cyclohexane (PubChem CID 175599922) has the molecular formula C13H14N4O4
and a molecular weight of 290.28 g/mol. Its IUPAC name is 1-isocyanato-1,3,5-tris(isocyanatomethyl)cyclohexane.
Molecular Properties
| Compound Name | 1-isocyanato-1,3,5-tris(isocyanatomethyl)cyclohexane |
| PubChem CID | 175599922 |
| Molecular Formula | C13H14N4O4 |
| Molecular Weight | 290.28 g/mol |
| Exact Mass | 290.10 |
| IUPAC Name | 1-isocyanato-1,3,5-tris(isocyanatomethyl)cyclohexane |
| SMILES | O=C=NCC1CC(CN=C=O)CC(CN=C=O)(N=C=O)C1 |
| InChI | InChI=1S/C13H14N4O4/c18-7-14-4-11-1-12(5-15-8-19)3-13(2-11,17-10-21)6-16-9-20/h11-12H,1-6H2 |
| InChIKey | ZGVKFPANOBFDLB-UHFFFAOYSA-N |
| XLogP | 0.48 |
| TPSA | 117.72 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 21 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 290.28 |
| LogP ≤ 5 | 0.48 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 8 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'isocyanate', 'substructure': 'N/A'} |
|---|
Analyze 1-isocyanato-1,3,5-tris(isocyanatomethyl)cyclohexane with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 1-isocyanato-1,3,5-tris(isocyanatomethyl)cyclohexane?
The IUPAC name of 1-isocyanato-1,3,5-tris(isocyanatomethyl)cyclohexane (CID 175599922) is 1-isocyanato-1,3,5-tris(isocyanatomethyl)cyclohexane.
What is the SMILES notation for 1-isocyanato-1,3,5-tris(isocyanatomethyl)cyclohexane?
The canonical SMILES for 1-isocyanato-1,3,5-tris(isocyanatomethyl)cyclohexane is O=C=NCC1CC(CN=C=O)CC(CN=C=O)(N=C=O)C1.
What is the InChIKey of 1-isocyanato-1,3,5-tris(isocyanatomethyl)cyclohexane?
The InChIKey is ZGVKFPANOBFDLB-UHFFFAOYSA-N. The full InChI is InChI=1S/C13H14N4O4/c18-7-14-4-11-1-12(5-15-8-19)3-13(2-11,17-10-21)6-16-9-20/h11-12H,1-6H2.
What are the key properties of 1-isocyanato-1,3,5-tris(isocyanatomethyl)cyclohexane?
1-isocyanato-1,3,5-tris(isocyanatomethyl)cyclohexane has a molecular weight of 290.28 g/mol, XLogP of 0.48, 7 rotatable bonds, 0 hydrogen bond donors, and 8 hydrogen bond acceptors.
Where does this data come from?
All data for 1-isocyanato-1,3,5-tris(isocyanatomethyl)cyclohexane is sourced from PubChem (CID 175599922), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).