C18H30O4 — CID 175599984
tert-butyl 4-(2,4,4,5-tetramethyl-1,3-dioxolan-2-yl)cyclohex-3-ene-1-carboxylate (PubChem CID 175599984) has the molecular formula C18H30O4 and a molecular weight of 310.43 g/mol. Its IUPAC name is tert-butyl 4-(2,4,4,5-tetramethyl-1,3-dioxolan-2-yl)cyclohex-3-ene-1-carboxylate.
| Compound Name | tert-butyl 4-(2,4,4,5-tetramethyl-1,3-dioxolan-2-yl)cyclohex-3-ene-1-carboxylate |
|---|---|
| PubChem CID | 175599984 |
| Molecular Formula | C18H30O4 |
| Molecular Weight | 310.43 g/mol |
| Exact Mass | 310.21 |
| IUPAC Name | tert-butyl 4-(2,4,4,5-tetramethyl-1,3-dioxolan-2-yl)cyclohex-3-ene-1-carboxylate |
| SMILES | CC1OC(C)(C2=CCC(C(=O)OC(C)(C)C)CC2)OC1(C)C |
| InChI | InChI=1S/C18H30O4/c1-12-17(5,6)22-18(7,20-12)14-10-8-13(9-11-14)15(19)21-16(2,3)4/h10,12-13H,8-9,11H2,1-7H3 |
| InChIKey | ISRKSWACCCGPGU-UHFFFAOYSA-N |
| XLogP | 3.98 |
| TPSA | 44.76 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 22 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 310.43 |
| LogP ≤ 5 | 3.98 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|