C22H31F3N2O2Si — CID 175600460
N-[3-[[tert-butyl(dimethyl)silyl]oxymethyl]-4-(2-piperidin-4-ylethynyl)phenyl]-2,2,2-trifluoroacetamide (PubChem CID 175600460) has the molecular formula C22H31F3N2O2Si and a molecular weight of 440.58 g/mol. Its IUPAC name is N-[3-[[tert-butyl(dimethyl)silyl]oxymethyl]-4-(2-piperidin-4-ylethynyl)phenyl]-2,2,2-trifluoroacetamide.
| Compound Name | N-[3-[[tert-butyl(dimethyl)silyl]oxymethyl]-4-(2-piperidin-4-ylethynyl)phenyl]-2,2,2-trifluoroacetamide |
|---|---|
| PubChem CID | 175600460 |
| Molecular Formula | C22H31F3N2O2Si |
| Molecular Weight | 440.58 g/mol |
| Exact Mass | 440.21 |
| IUPAC Name | N-[3-[[tert-butyl(dimethyl)silyl]oxymethyl]-4-(2-piperidin-4-ylethynyl)phenyl]-2,2,2-trifluoroacetamide |
| SMILES | CC(C)(C)[Si](C)(C)OCc1cc(NC(=O)C(F)(F)F)ccc1C#CC1CCNCC1 |
| InChI | InChI=1S/C22H31F3N2O2Si/c1-21(2,3)30(4,5)29-15-18-14-19(27-20(28)22(23,24)25)9-8-17(18)7-6-16-10-12-26-13-11-16/h8-9,14,16,26H,10-13,15H2,1-5H3,(H,27,28) |
| InChIKey | ANMNFZUBGCXWHP-UHFFFAOYSA-N |
| XLogP | 5.06 |
| TPSA | 50.36 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 30 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 440.58 |
| LogP ≤ 5 | 5.06 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'heavy_metal', 'substructure': 'N/A'}, {'alert_name': 'triple_bond', 'substructure': 'N/A'} |
|---|