C13H19N3O4 — CID 175600816
[2-[(3-amino-3-phenylpropoxy)methylamino]-2-oxoethyl] carbamate (PubChem CID 175600816) has the molecular formula C13H19N3O4 and a molecular weight of 281.31 g/mol. Its IUPAC name is [2-[(3-amino-3-phenylpropoxy)methylamino]-2-oxoethyl] carbamate.
| Compound Name | [2-[(3-amino-3-phenylpropoxy)methylamino]-2-oxoethyl] carbamate |
|---|---|
| PubChem CID | 175600816 |
| Molecular Formula | C13H19N3O4 |
| Molecular Weight | 281.31 g/mol |
| Exact Mass | 281.14 |
| IUPAC Name | [2-[(3-amino-3-phenylpropoxy)methylamino]-2-oxoethyl] carbamate |
| SMILES | NC(=O)OCC(=O)NCOCCC(N)c1ccccc1 |
| InChI | InChI=1S/C13H19N3O4/c14-11(10-4-2-1-3-5-10)6-7-19-9-16-12(17)8-20-13(15)18/h1-5,11H,6-9,14H2,(H2,15,18)(H,16,17) |
| InChIKey | QHZAIVIMQKWLOL-UHFFFAOYSA-N |
| XLogP | 0.26 |
| TPSA | 116.67 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 281.31 |
| LogP ≤ 5 | 0.26 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'het-C-het_not_in_ring', 'substructure': 'N/A'} |
|---|