C32H30Cl2N4O4 — CID 175601170
(2S)-2-amino-4-[bis[[2-[(3-chlorobenzoyl)amino]phenyl]methyl]amino]butanoic acid (PubChem CID 175601170) has the molecular formula C32H30Cl2N4O4 and a molecular weight of 605.52 g/mol. Its IUPAC name is (2S)-2-amino-4-[bis[[2-[(3-chlorobenzoyl)amino]phenyl]methyl]amino]butanoic acid.
| Compound Name | (2S)-2-amino-4-[bis[[2-[(3-chlorobenzoyl)amino]phenyl]methyl]amino]butanoic acid |
|---|---|
| PubChem CID | 175601170 |
| Molecular Formula | C32H30Cl2N4O4 |
| Molecular Weight | 605.52 g/mol |
| Exact Mass | 604.16 |
| IUPAC Name | (2S)-2-amino-4-[bis[[2-[(3-chlorobenzoyl)amino]phenyl]methyl]amino]butanoic acid |
| SMILES | N[C@@H](CCN(Cc1ccccc1NC(=O)c1cccc(Cl)c1)Cc1ccccc1NC(=O)c1cccc(Cl)c1)C(=O)O |
| InChI | InChI=1S/C32H30Cl2N4O4/c33-25-11-5-9-21(17-25)30(39)36-28-13-3-1-7-23(28)19-38(16-15-27(35)32(41)42)20-24-8-2-4-14-29(24)37-31(40)22-10-6-12-26(34)18-22/h1-14,17-18,27H,15-16,19-20,35H2,(H,36,39)(H,37,40)(H,41,42)/t27-/m0/s1 |
| InChIKey | CFZDAMCTDBJSSW-MHZLTWQESA-N |
| XLogP | 6.30 |
| TPSA | 124.76 Ų |
| H-Bond Donors | 4 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 12 |
| Heavy Atoms | 42 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 605.52 |
| LogP ≤ 5 | 6.30 |
| H-Bond Donors ≤ 5 | 4 |
| H-Bond Acceptors ≤ 10 | 5 |