C26H25N3O3 — CID 175601508
4-amino-1-(3,4-dihydroxy-1,1,1-triphenylbutan-2-yl)pyrimidin-2-one (PubChem CID 175601508) has the molecular formula C26H25N3O3 and a molecular weight of 427.50 g/mol. Its IUPAC name is 4-amino-1-(3,4-dihydroxy-1,1,1-triphenylbutan-2-yl)pyrimidin-2-one.
| Compound Name | 4-amino-1-(3,4-dihydroxy-1,1,1-triphenylbutan-2-yl)pyrimidin-2-one |
|---|---|
| PubChem CID | 175601508 |
| Molecular Formula | C26H25N3O3 |
| Molecular Weight | 427.50 g/mol |
| Exact Mass | 427.19 |
| IUPAC Name | 4-amino-1-(3,4-dihydroxy-1,1,1-triphenylbutan-2-yl)pyrimidin-2-one |
| SMILES | Nc1ccn(C(C(O)CO)C(c2ccccc2)(c2ccccc2)c2ccccc2)c(=O)n1 |
| InChI | InChI=1S/C26H25N3O3/c27-23-16-17-29(25(32)28-23)24(22(31)18-30)26(19-10-4-1-5-11-19,20-12-6-2-7-13-20)21-14-8-3-9-15-21/h1-17,22,24,30-31H,18H2,(H2,27,28,32) |
| InChIKey | VGLVARPZQOMPSD-UHFFFAOYSA-N |
| XLogP | 2.75 |
| TPSA | 101.37 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 32 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 427.50 |
| LogP ≤ 5 | 2.75 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'triphenyl_methyl-silyl', 'substructure': 'N/A'} |
|---|