C20H22F3N9O — CID 175601725
(7S)-4,7,8-trimethyl-2-[[6-[[1-(1,2,2-trifluoroethyl)pyrazol-4-yl]amino]-3-pyridinyl]methylamino]-5,7-dihydropteridin-6-one (PubChem CID 175601725) has the molecular formula C20H22F3N9O and a molecular weight of 461.45 g/mol. Its IUPAC name is (7S)-4,7,8-trimethyl-2-[[6-[[1-(1,2,2-trifluoroethyl)pyrazol-4-yl]amino]-3-pyridinyl]methylamino]-5,7-dihydropteridin-6-one.
| Compound Name | (7S)-4,7,8-trimethyl-2-[[6-[[1-(1,2,2-trifluoroethyl)pyrazol-4-yl]amino]-3-pyridinyl]methylamino]-5,7-dihydropteridin-6-one |
|---|---|
| PubChem CID | 175601725 |
| Molecular Formula | C20H22F3N9O |
| Molecular Weight | 461.45 g/mol |
| Exact Mass | 461.19 |
| IUPAC Name | (7S)-4,7,8-trimethyl-2-[[6-[[1-(1,2,2-trifluoroethyl)pyrazol-4-yl]amino]-3-pyridinyl]methylamino]-5,7-dihydropteridin-6-one |
| SMILES | Cc1nc(NCc2ccc(Nc3cnn(C(F)C(F)F)c3)nc2)nc2c1NC(=O)[C@H](C)N2C |
| InChI | InChI=1S/C20H22F3N9O/c1-10-15-18(31(3)11(2)19(33)29-15)30-20(27-10)25-7-12-4-5-14(24-6-12)28-13-8-26-32(9-13)17(23)16(21)22/h4-6,8-9,11,16-17H,7H2,1-3H3,(H,24,28)(H,29,33)(H,25,27,30)/t11-,17?/m0/s1 |
| InChIKey | KQPCNVUXWQJWFD-PIJUOJQZSA-N |
| XLogP | 3.24 |
| TPSA | 112.89 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 9 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 33 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 461.45 |
| LogP ≤ 5 | 3.24 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 9 |