About [3-(2-amino-2-oxoethyl)-5-chloro-2-oxo-1H-indol-3-yl] thiane-4-carboxylate
[3-(2-amino-2-oxoethyl)-5-chloro-2-oxo-1H-indol-3-yl] thiane-4-carboxylate (PubChem CID 175603382) has the molecular formula C16H17ClN2O4S
and a molecular weight of 368.84 g/mol. Its IUPAC name is [3-(2-amino-2-oxoethyl)-5-chloro-2-oxo-1H-indol-3-yl] thiane-4-carboxylate.
Molecular Properties
| Compound Name | [3-(2-amino-2-oxoethyl)-5-chloro-2-oxo-1H-indol-3-yl] thiane-4-carboxylate |
| PubChem CID | 175603382 |
| Molecular Formula | C16H17ClN2O4S |
| Molecular Weight | 368.84 g/mol |
| Exact Mass | 368.06 |
| IUPAC Name | [3-(2-amino-2-oxoethyl)-5-chloro-2-oxo-1H-indol-3-yl] thiane-4-carboxylate |
| SMILES | NC(=O)CC1(OC(=O)C2CCSCC2)C(=O)Nc2ccc(Cl)cc21 |
| InChI | InChI=1S/C16H17ClN2O4S/c17-10-1-2-12-11(7-10)16(8-13(18)20,15(22)19-12)23-14(21)9-3-5-24-6-4-9/h1-2,7,9H,3-6,8H2,(H2,18,20)(H,19,22) |
| InChIKey | NUZIWEQDMWQJDO-UHFFFAOYSA-N |
| XLogP | 2.05 |
| TPSA | 98.49 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 24 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 368.84 |
| LogP ≤ 5 | 2.05 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |
Analyze [3-(2-amino-2-oxoethyl)-5-chloro-2-oxo-1H-indol-3-yl] thiane-4-carboxylate with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of [3-(2-amino-2-oxoethyl)-5-chloro-2-oxo-1H-indol-3-yl] thiane-4-carboxylate?
The IUPAC name of [3-(2-amino-2-oxoethyl)-5-chloro-2-oxo-1H-indol-3-yl] thiane-4-carboxylate (CID 175603382) is [3-(2-amino-2-oxoethyl)-5-chloro-2-oxo-1H-indol-3-yl] thiane-4-carboxylate.
What is the SMILES notation for [3-(2-amino-2-oxoethyl)-5-chloro-2-oxo-1H-indol-3-yl] thiane-4-carboxylate?
The canonical SMILES for [3-(2-amino-2-oxoethyl)-5-chloro-2-oxo-1H-indol-3-yl] thiane-4-carboxylate is NC(=O)CC1(OC(=O)C2CCSCC2)C(=O)Nc2ccc(Cl)cc21.
What is the InChIKey of [3-(2-amino-2-oxoethyl)-5-chloro-2-oxo-1H-indol-3-yl] thiane-4-carboxylate?
The InChIKey is NUZIWEQDMWQJDO-UHFFFAOYSA-N. The full InChI is InChI=1S/C16H17ClN2O4S/c17-10-1-2-12-11(7-10)16(8-13(18)20,15(22)19-12)23-14(21)9-3-5-24-6-4-9/h1-2,7,9H,3-6,8H2,(H2,18,20)(H,19,22).
What are the key properties of [3-(2-amino-2-oxoethyl)-5-chloro-2-oxo-1H-indol-3-yl] thiane-4-carboxylate?
[3-(2-amino-2-oxoethyl)-5-chloro-2-oxo-1H-indol-3-yl] thiane-4-carboxylate has a molecular weight of 368.84 g/mol, XLogP of 2.05, 4 rotatable bonds, 2 hydrogen bond donors, and 5 hydrogen bond acceptors.
Where does this data come from?
All data for [3-(2-amino-2-oxoethyl)-5-chloro-2-oxo-1H-indol-3-yl] thiane-4-carboxylate is sourced from PubChem (CID 175603382), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).