About 1-[[2-(4,7-dichloro-3-hydroxy-2-oxo-1H-indol-3-yl)acetyl]amino]cyclohexane-1-carboxylic acid
1-[[2-(4,7-dichloro-3-hydroxy-2-oxo-1H-indol-3-yl)acetyl]amino]cyclohexane-1-carboxylic acid (PubChem CID 175603391) has the molecular formula C17H18Cl2N2O5
and a molecular weight of 401.25 g/mol. Its IUPAC name is 1-[[2-(4,7-dichloro-3-hydroxy-2-oxo-1H-indol-3-yl)acetyl]amino]cyclohexane-1-carboxylic acid.
Molecular Properties
| Compound Name | 1-[[2-(4,7-dichloro-3-hydroxy-2-oxo-1H-indol-3-yl)acetyl]amino]cyclohexane-1-carboxylic acid |
| PubChem CID | 175603391 |
| Molecular Formula | C17H18Cl2N2O5 |
| Molecular Weight | 401.25 g/mol |
| Exact Mass | 400.06 |
| IUPAC Name | 1-[[2-(4,7-dichloro-3-hydroxy-2-oxo-1H-indol-3-yl)acetyl]amino]cyclohexane-1-carboxylic acid |
| SMILES | O=C(CC1(O)C(=O)Nc2c(Cl)ccc(Cl)c21)NC1(C(=O)O)CCCCC1 |
| InChI | InChI=1S/C17H18Cl2N2O5/c18-9-4-5-10(19)13-12(9)17(26,14(23)20-13)8-11(22)21-16(15(24)25)6-2-1-3-7-16/h4-5,26H,1-3,6-8H2,(H,20,23)(H,21,22)(H,24,25) |
| InChIKey | CONJYAZTUWANHB-UHFFFAOYSA-N |
| XLogP | 2.43 |
| TPSA | 115.73 Ų |
| H-Bond Donors | 4 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 26 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 401.25 |
| LogP ≤ 5 | 2.43 |
| H-Bond Donors ≤ 5 | 4 |
| H-Bond Acceptors ≤ 10 | 4 |
Analyze 1-[[2-(4,7-dichloro-3-hydroxy-2-oxo-1H-indol-3-yl)acetyl]amino]cyclohexane-1-carboxylic acid with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 1-[[2-(4,7-dichloro-3-hydroxy-2-oxo-1H-indol-3-yl)acetyl]amino]cyclohexane-1-carboxylic acid?
The IUPAC name of 1-[[2-(4,7-dichloro-3-hydroxy-2-oxo-1H-indol-3-yl)acetyl]amino]cyclohexane-1-carboxylic acid (CID 175603391) is 1-[[2-(4,7-dichloro-3-hydroxy-2-oxo-1H-indol-3-yl)acetyl]amino]cyclohexane-1-carboxylic acid.
What is the SMILES notation for 1-[[2-(4,7-dichloro-3-hydroxy-2-oxo-1H-indol-3-yl)acetyl]amino]cyclohexane-1-carboxylic acid?
The canonical SMILES for 1-[[2-(4,7-dichloro-3-hydroxy-2-oxo-1H-indol-3-yl)acetyl]amino]cyclohexane-1-carboxylic acid is O=C(CC1(O)C(=O)Nc2c(Cl)ccc(Cl)c21)NC1(C(=O)O)CCCCC1.
What is the InChIKey of 1-[[2-(4,7-dichloro-3-hydroxy-2-oxo-1H-indol-3-yl)acetyl]amino]cyclohexane-1-carboxylic acid?
The InChIKey is CONJYAZTUWANHB-UHFFFAOYSA-N. The full InChI is InChI=1S/C17H18Cl2N2O5/c18-9-4-5-10(19)13-12(9)17(26,14(23)20-13)8-11(22)21-16(15(24)25)6-2-1-3-7-16/h4-5,26H,1-3,6-8H2,(H,20,23)(H,21,22)(H,24,25).
What are the key properties of 1-[[2-(4,7-dichloro-3-hydroxy-2-oxo-1H-indol-3-yl)acetyl]amino]cyclohexane-1-carboxylic acid?
1-[[2-(4,7-dichloro-3-hydroxy-2-oxo-1H-indol-3-yl)acetyl]amino]cyclohexane-1-carboxylic acid has a molecular weight of 401.25 g/mol, XLogP of 2.43, 4 rotatable bonds, 4 hydrogen bond donors, and 4 hydrogen bond acceptors.
Where does this data come from?
All data for 1-[[2-(4,7-dichloro-3-hydroxy-2-oxo-1H-indol-3-yl)acetyl]amino]cyclohexane-1-carboxylic acid is sourced from PubChem (CID 175603391), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).