About (3S)-5,5-dimethyl-4-propan-2-yl-3-prop-2-enoylpyrrolidin-2-one
(3S)-5,5-dimethyl-4-propan-2-yl-3-prop-2-enoylpyrrolidin-2-one (PubChem CID 175603424) has the molecular formula C12H19NO2
and a molecular weight of 209.29 g/mol. Its IUPAC name is (3S)-5,5-dimethyl-4-propan-2-yl-3-prop-2-enoylpyrrolidin-2-one.
Molecular Properties
| Compound Name | (3S)-5,5-dimethyl-4-propan-2-yl-3-prop-2-enoylpyrrolidin-2-one |
| PubChem CID | 175603424 |
| Molecular Formula | C12H19NO2 |
| Molecular Weight | 209.29 g/mol |
| Exact Mass | 209.14 |
| IUPAC Name | (3S)-5,5-dimethyl-4-propan-2-yl-3-prop-2-enoylpyrrolidin-2-one |
| SMILES | C=CC(=O)[C@H]1C(=O)NC(C)(C)C1C(C)C |
| InChI | InChI=1S/C12H19NO2/c1-6-8(14)9-10(7(2)3)12(4,5)13-11(9)15/h6-7,9-10H,1H2,2-5H3,(H,13,15)/t9-,10?/m1/s1 |
| InChIKey | GLVWONBMJTZKAF-YHMJZVADSA-N |
| XLogP | 1.54 |
| TPSA | 46.17 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 15 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 209.29 |
| LogP ≤ 5 | 1.54 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'beta-keto/anhydride', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|
Analyze (3S)-5,5-dimethyl-4-propan-2-yl-3-prop-2-enoylpyrrolidin-2-one with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of (3S)-5,5-dimethyl-4-propan-2-yl-3-prop-2-enoylpyrrolidin-2-one?
The IUPAC name of (3S)-5,5-dimethyl-4-propan-2-yl-3-prop-2-enoylpyrrolidin-2-one (CID 175603424) is (3S)-5,5-dimethyl-4-propan-2-yl-3-prop-2-enoylpyrrolidin-2-one.
What is the SMILES notation for (3S)-5,5-dimethyl-4-propan-2-yl-3-prop-2-enoylpyrrolidin-2-one?
The canonical SMILES for (3S)-5,5-dimethyl-4-propan-2-yl-3-prop-2-enoylpyrrolidin-2-one is C=CC(=O)[C@H]1C(=O)NC(C)(C)C1C(C)C.
What is the InChIKey of (3S)-5,5-dimethyl-4-propan-2-yl-3-prop-2-enoylpyrrolidin-2-one?
The InChIKey is GLVWONBMJTZKAF-YHMJZVADSA-N. The full InChI is InChI=1S/C12H19NO2/c1-6-8(14)9-10(7(2)3)12(4,5)13-11(9)15/h6-7,9-10H,1H2,2-5H3,(H,13,15)/t9-,10?/m1/s1.
What are the key properties of (3S)-5,5-dimethyl-4-propan-2-yl-3-prop-2-enoylpyrrolidin-2-one?
(3S)-5,5-dimethyl-4-propan-2-yl-3-prop-2-enoylpyrrolidin-2-one has a molecular weight of 209.29 g/mol, XLogP of 1.54, 3 rotatable bonds, 1 hydrogen bond donors, and 2 hydrogen bond acceptors.
Where does this data come from?
All data for (3S)-5,5-dimethyl-4-propan-2-yl-3-prop-2-enoylpyrrolidin-2-one is sourced from PubChem (CID 175603424), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).