About 2-propylsulfonylpyridine tetrafluoroborate
2-propylsulfonylpyridine tetrafluoroborate (PubChem CID 175603723) has the molecular formula C8H11BF4NO2S-
and a molecular weight of 272.05 g/mol. Its IUPAC name is 2-propylsulfonylpyridine tetrafluoroborate.
Molecular Properties
| Compound Name | 2-propylsulfonylpyridine tetrafluoroborate |
| PubChem CID | 175603723 |
| Molecular Formula | C8H11BF4NO2S- |
| Molecular Weight | 272.05 g/mol |
| Exact Mass | 272.05 |
| IUPAC Name | 2-propylsulfonylpyridine tetrafluoroborate |
| SMILES | CCCS(=O)(=O)c1ccccn1.F[B-](F)(F)F |
| InChI | InChI=1S/C8H11NO2S.BF4/c1-2-7-12(10,11)8-5-3-4-6-9-8;2-1(3,4)5/h3-6H,2,7H2,1H3;/q;-1 |
| InChIKey | NHQQUGCVIHFKGY-UHFFFAOYSA-N |
| XLogP | 2.57 |
| TPSA | 47.03 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 17 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 272.05 |
| LogP ≤ 5 | 2.57 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'heavy_metal', 'substructure': 'N/A'} |
|---|
Analyze 2-propylsulfonylpyridine tetrafluoroborate with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 2-propylsulfonylpyridine tetrafluoroborate?
The IUPAC name of 2-propylsulfonylpyridine tetrafluoroborate (CID 175603723) is 2-propylsulfonylpyridine tetrafluoroborate.
What is the SMILES notation for 2-propylsulfonylpyridine tetrafluoroborate?
The canonical SMILES for 2-propylsulfonylpyridine tetrafluoroborate is CCCS(=O)(=O)c1ccccn1.F[B-](F)(F)F.
What is the InChIKey of 2-propylsulfonylpyridine tetrafluoroborate?
The InChIKey is NHQQUGCVIHFKGY-UHFFFAOYSA-N. The full InChI is InChI=1S/C8H11NO2S.BF4/c1-2-7-12(10,11)8-5-3-4-6-9-8;2-1(3,4)5/h3-6H,2,7H2,1H3;/q;-1.
What are the key properties of 2-propylsulfonylpyridine tetrafluoroborate?
2-propylsulfonylpyridine tetrafluoroborate has a molecular weight of 272.05 g/mol, XLogP of 2.57, 3 rotatable bonds, 0 hydrogen bond donors, and 3 hydrogen bond acceptors.
Where does this data come from?
All data for 2-propylsulfonylpyridine tetrafluoroborate is sourced from PubChem (CID 175603723), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).