C20H34N2O3Si — CID 175604345
triethoxy-[3-[3-(2-phenylethyl)-2H-imidazol-1-yl]propyl]silane (PubChem CID 175604345) has the molecular formula C20H34N2O3Si and a molecular weight of 378.59 g/mol. Its IUPAC name is triethoxy-[3-[3-(2-phenylethyl)-2H-imidazol-1-yl]propyl]silane.
| Compound Name | triethoxy-[3-[3-(2-phenylethyl)-2H-imidazol-1-yl]propyl]silane |
|---|---|
| PubChem CID | 175604345 |
| Molecular Formula | C20H34N2O3Si |
| Molecular Weight | 378.59 g/mol |
| Exact Mass | 378.23 |
| IUPAC Name | triethoxy-[3-[3-(2-phenylethyl)-2H-imidazol-1-yl]propyl]silane |
| SMILES | CCO[Si](CCCN1C=CN(CCc2ccccc2)C1)(OCC)OCC |
| InChI | InChI=1S/C20H34N2O3Si/c1-4-23-26(24-5-2,25-6-3)18-10-14-21-16-17-22(19-21)15-13-20-11-8-7-9-12-20/h7-9,11-12,16-17H,4-6,10,13-15,18-19H2,1-3H3 |
| InChIKey | QVHJUBTXXDGSJY-UHFFFAOYSA-N |
| XLogP | 3.71 |
| TPSA | 34.17 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 13 |
| Heavy Atoms | 26 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 378.59 |
| LogP ≤ 5 | 3.71 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'heavy_metal', 'substructure': 'N/A'} |
|---|