About N-benzyl-6-(1H-pyrrolo[2,3-b]pyridin-3-yl)quinazolin-4-amine
N-benzyl-6-(1H-pyrrolo[2,3-b]pyridin-3-yl)quinazolin-4-amine (PubChem CID 175604588) has the molecular formula C22H17N5
and a molecular weight of 351.41 g/mol. Its IUPAC name is N-benzyl-6-(1H-pyrrolo[2,3-b]pyridin-3-yl)quinazolin-4-amine.
Molecular Properties
| Compound Name | N-benzyl-6-(1H-pyrrolo[2,3-b]pyridin-3-yl)quinazolin-4-amine |
| PubChem CID | 175604588 |
| Molecular Formula | C22H17N5 |
| Molecular Weight | 351.41 g/mol |
| Exact Mass | 351.15 |
| IUPAC Name | N-benzyl-6-(1H-pyrrolo[2,3-b]pyridin-3-yl)quinazolin-4-amine |
| SMILES | c1ccc(CNc2ncnc3ccc(-c4c[nH]c5ncccc45)cc23)cc1 |
| InChI | InChI=1S/C22H17N5/c1-2-5-15(6-3-1)12-24-22-18-11-16(8-9-20(18)26-14-27-22)19-13-25-21-17(19)7-4-10-23-21/h1-11,13-14H,12H2,(H,23,25)(H,24,26,27) |
| InChIKey | NPHSWXYIQFTYFN-UHFFFAOYSA-N |
| XLogP | 4.79 |
| TPSA | 66.49 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 27 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 351.41 |
| LogP ≤ 5 | 4.79 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |
Analyze N-benzyl-6-(1H-pyrrolo[2,3-b]pyridin-3-yl)quinazolin-4-amine with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of N-benzyl-6-(1H-pyrrolo[2,3-b]pyridin-3-yl)quinazolin-4-amine?
The IUPAC name of N-benzyl-6-(1H-pyrrolo[2,3-b]pyridin-3-yl)quinazolin-4-amine (CID 175604588) is N-benzyl-6-(1H-pyrrolo[2,3-b]pyridin-3-yl)quinazolin-4-amine.
What is the SMILES notation for N-benzyl-6-(1H-pyrrolo[2,3-b]pyridin-3-yl)quinazolin-4-amine?
The canonical SMILES for N-benzyl-6-(1H-pyrrolo[2,3-b]pyridin-3-yl)quinazolin-4-amine is c1ccc(CNc2ncnc3ccc(-c4c[nH]c5ncccc45)cc23)cc1.
What is the InChIKey of N-benzyl-6-(1H-pyrrolo[2,3-b]pyridin-3-yl)quinazolin-4-amine?
The InChIKey is NPHSWXYIQFTYFN-UHFFFAOYSA-N. The full InChI is InChI=1S/C22H17N5/c1-2-5-15(6-3-1)12-24-22-18-11-16(8-9-20(18)26-14-27-22)19-13-25-21-17(19)7-4-10-23-21/h1-11,13-14H,12H2,(H,23,25)(H,24,26,27).
What are the key properties of N-benzyl-6-(1H-pyrrolo[2,3-b]pyridin-3-yl)quinazolin-4-amine?
N-benzyl-6-(1H-pyrrolo[2,3-b]pyridin-3-yl)quinazolin-4-amine has a molecular weight of 351.41 g/mol, XLogP of 4.79, 4 rotatable bonds, 2 hydrogen bond donors, and 4 hydrogen bond acceptors.
Where does this data come from?
All data for N-benzyl-6-(1H-pyrrolo[2,3-b]pyridin-3-yl)quinazolin-4-amine is sourced from PubChem (CID 175604588), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).