C14H19N3O3 — CID 175604906
[4-[[(2-amino-3-cyclopropylpropanoyl)amino]methyl]phenyl] carbamate (PubChem CID 175604906) has the molecular formula C14H19N3O3 and a molecular weight of 277.32 g/mol. Its IUPAC name is [4-[[(2-amino-3-cyclopropylpropanoyl)amino]methyl]phenyl] carbamate.
| Compound Name | [4-[[(2-amino-3-cyclopropylpropanoyl)amino]methyl]phenyl] carbamate |
|---|---|
| PubChem CID | 175604906 |
| Molecular Formula | C14H19N3O3 |
| Molecular Weight | 277.32 g/mol |
| Exact Mass | 277.14 |
| IUPAC Name | [4-[[(2-amino-3-cyclopropylpropanoyl)amino]methyl]phenyl] carbamate |
| SMILES | NC(=O)Oc1ccc(CNC(=O)C(N)CC2CC2)cc1 |
| InChI | InChI=1S/C14H19N3O3/c15-12(7-9-1-2-9)13(18)17-8-10-3-5-11(6-4-10)20-14(16)19/h3-6,9,12H,1-2,7-8,15H2,(H2,16,19)(H,17,18) |
| InChIKey | ZEHFDHGQPYENQL-UHFFFAOYSA-N |
| XLogP | 0.89 |
| TPSA | 107.44 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 277.32 |
| LogP ≤ 5 | 0.89 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 4 |