C20H37NO4Si — CID 175605042
[2,2-dimethyl-5-[4-tri(propan-2-yl)silylbuta-1,3-dienyl]-1,3-dioxan-5-yl] carbamate (PubChem CID 175605042) has the molecular formula C20H37NO4Si and a molecular weight of 383.61 g/mol. Its IUPAC name is [2,2-dimethyl-5-[4-tri(propan-2-yl)silylbuta-1,3-dienyl]-1,3-dioxan-5-yl] carbamate.
| Compound Name | [2,2-dimethyl-5-[4-tri(propan-2-yl)silylbuta-1,3-dienyl]-1,3-dioxan-5-yl] carbamate |
|---|---|
| PubChem CID | 175605042 |
| Molecular Formula | C20H37NO4Si |
| Molecular Weight | 383.61 g/mol |
| Exact Mass | 383.25 |
| IUPAC Name | [2,2-dimethyl-5-[4-tri(propan-2-yl)silylbuta-1,3-dienyl]-1,3-dioxan-5-yl] carbamate |
| SMILES | CC(C)[Si](C=CC=CC1(OC(N)=O)COC(C)(C)OC1)(C(C)C)C(C)C |
| InChI | InChI=1S/C20H37NO4Si/c1-15(2)26(16(3)4,17(5)6)12-10-9-11-20(25-18(21)22)13-23-19(7,8)24-14-20/h9-12,15-17H,13-14H2,1-8H3,(H2,21,22) |
| InChIKey | LFUVKLXELDQECK-UHFFFAOYSA-N |
| XLogP | 4.93 |
| TPSA | 70.78 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 26 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 383.61 |
| LogP ≤ 5 | 4.93 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'heavy_metal', 'substructure': 'N/A'}, {'alert_name': 'polyene', 'substructure': 'N/A'} |
|---|