C22H44NO11P — CID 175605123
2-amino-3-hydroxypropanoic acid;(2-octanoyloxy-3-phosphonooxypropyl) octanoate (PubChem CID 175605123) has the molecular formula C22H44NO11P and a molecular weight of 529.56 g/mol. Its IUPAC name is 2-amino-3-hydroxypropanoic acid;(2-octanoyloxy-3-phosphonooxypropyl) octanoate.
| Compound Name | 2-amino-3-hydroxypropanoic acid;(2-octanoyloxy-3-phosphonooxypropyl) octanoate |
|---|---|
| PubChem CID | 175605123 |
| Molecular Formula | C22H44NO11P |
| Molecular Weight | 529.56 g/mol |
| Exact Mass | 529.27 |
| IUPAC Name | 2-amino-3-hydroxypropanoic acid;(2-octanoyloxy-3-phosphonooxypropyl) octanoate |
| SMILES | CCCCCCCC(=O)OCC(COP(=O)(O)O)OC(=O)CCCCCCC.NC(CO)C(=O)O |
| InChI | InChI=1S/C19H37O8P.C3H7NO3/c1-3-5-7-9-11-13-18(20)25-15-17(16-26-28(22,23)24)27-19(21)14-12-10-8-6-4-2;4-2(1-5)3(6)7/h17H,3-16H2,1-2H3,(H2,22,23,24);2,5H,1,4H2,(H,6,7) |
| InChIKey | VGSJACYCJYPJJB-UHFFFAOYSA-N |
| XLogP | 2.66 |
| TPSA | 202.91 Ų |
| H-Bond Donors | 5 |
| H-Bond Acceptors | 9 |
| Rotatable Bonds | 20 |
| Heavy Atoms | 35 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 529.56 |
| LogP ≤ 5 | 2.66 |
| H-Bond Donors ≤ 5 | 5 |
| H-Bond Acceptors ≤ 10 | 9 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'phosphor', 'substructure': 'N/A'} |
|---|