About 4-piperazin-1-yl-N-pyrimidin-2-yl-1,2,5-thiadiazol-3-amine;hydrochloride
4-piperazin-1-yl-N-pyrimidin-2-yl-1,2,5-thiadiazol-3-amine;hydrochloride (PubChem CID 175605799) has the molecular formula C10H14ClN7S
and a molecular weight of 299.79 g/mol. Its IUPAC name is 4-piperazin-1-yl-N-pyrimidin-2-yl-1,2,5-thiadiazol-3-amine;hydrochloride.
Molecular Properties
| Compound Name | 4-piperazin-1-yl-N-pyrimidin-2-yl-1,2,5-thiadiazol-3-amine;hydrochloride |
| PubChem CID | 175605799 |
| Molecular Formula | C10H14ClN7S |
| Molecular Weight | 299.79 g/mol |
| Exact Mass | 299.07 |
| IUPAC Name | 4-piperazin-1-yl-N-pyrimidin-2-yl-1,2,5-thiadiazol-3-amine;hydrochloride |
| SMILES | Cl.c1cnc(Nc2nsnc2N2CCNCC2)nc1 |
| InChI | InChI=1S/C10H13N7S.ClH/c1-2-12-10(13-3-1)14-8-9(16-18-15-8)17-6-4-11-5-7-17;/h1-3,11H,4-7H2,(H,12,13,14,15);1H |
| InChIKey | MQODCDLGWMCBSJ-UHFFFAOYSA-N |
| XLogP | 0.90 |
| TPSA | 78.86 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 19 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 299.79 |
| LogP ≤ 5 | 0.90 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 8 |
Analyze 4-piperazin-1-yl-N-pyrimidin-2-yl-1,2,5-thiadiazol-3-amine;hydrochloride with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 4-piperazin-1-yl-N-pyrimidin-2-yl-1,2,5-thiadiazol-3-amine;hydrochloride?
The IUPAC name of 4-piperazin-1-yl-N-pyrimidin-2-yl-1,2,5-thiadiazol-3-amine;hydrochloride (CID 175605799) is 4-piperazin-1-yl-N-pyrimidin-2-yl-1,2,5-thiadiazol-3-amine;hydrochloride.
What is the SMILES notation for 4-piperazin-1-yl-N-pyrimidin-2-yl-1,2,5-thiadiazol-3-amine;hydrochloride?
The canonical SMILES for 4-piperazin-1-yl-N-pyrimidin-2-yl-1,2,5-thiadiazol-3-amine;hydrochloride is Cl.c1cnc(Nc2nsnc2N2CCNCC2)nc1.
What is the InChIKey of 4-piperazin-1-yl-N-pyrimidin-2-yl-1,2,5-thiadiazol-3-amine;hydrochloride?
The InChIKey is MQODCDLGWMCBSJ-UHFFFAOYSA-N. The full InChI is InChI=1S/C10H13N7S.ClH/c1-2-12-10(13-3-1)14-8-9(16-18-15-8)17-6-4-11-5-7-17;/h1-3,11H,4-7H2,(H,12,13,14,15);1H.
What are the key properties of 4-piperazin-1-yl-N-pyrimidin-2-yl-1,2,5-thiadiazol-3-amine;hydrochloride?
4-piperazin-1-yl-N-pyrimidin-2-yl-1,2,5-thiadiazol-3-amine;hydrochloride has a molecular weight of 299.79 g/mol, XLogP of 0.90, 3 rotatable bonds, 2 hydrogen bond donors, and 8 hydrogen bond acceptors.
Where does this data come from?
All data for 4-piperazin-1-yl-N-pyrimidin-2-yl-1,2,5-thiadiazol-3-amine;hydrochloride is sourced from PubChem (CID 175605799), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).