C14H10Cl2N4O5S — CID 175605958
[4-[(2,5-dichloro-4,6-dimethylpyridine-3-carbonyl)amino]-2-pyridinyl] N-sulfonylcarbamate (PubChem CID 175605958) has the molecular formula C14H10Cl2N4O5S and a molecular weight of 417.23 g/mol. Its IUPAC name is [4-[(2,5-dichloro-4,6-dimethylpyridine-3-carbonyl)amino]-2-pyridinyl] N-sulfonylcarbamate.
| Compound Name | [4-[(2,5-dichloro-4,6-dimethylpyridine-3-carbonyl)amino]-2-pyridinyl] N-sulfonylcarbamate |
|---|---|
| PubChem CID | 175605958 |
| Molecular Formula | C14H10Cl2N4O5S |
| Molecular Weight | 417.23 g/mol |
| Exact Mass | 415.97 |
| IUPAC Name | [4-[(2,5-dichloro-4,6-dimethylpyridine-3-carbonyl)amino]-2-pyridinyl] N-sulfonylcarbamate |
| SMILES | Cc1nc(Cl)c(C(=O)Nc2ccnc(OC(=O)N=S(=O)=O)c2)c(C)c1Cl |
| InChI | InChI=1S/C14H10Cl2N4O5S/c1-6-10(12(16)18-7(2)11(6)15)13(21)19-8-3-4-17-9(5-8)25-14(22)20-26(23)24/h3-5H,1-2H3,(H,17,19,21) |
| InChIKey | CTCFOCGMTMVCHH-UHFFFAOYSA-N |
| XLogP | 3.21 |
| TPSA | 127.68 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 26 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 417.23 |
| LogP ≤ 5 | 3.21 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': '2-halo_pyridine', 'substructure': 'N/A'} |
|---|