C13H16N2O5S2 — CID 175606976
N-methyl-5-(3,4,5-trimethoxyphenyl)sulfonyl-1,3-thiazol-2-amine (PubChem CID 175606976) has the molecular formula C13H16N2O5S2 and a molecular weight of 344.41 g/mol. Its IUPAC name is N-methyl-5-(3,4,5-trimethoxyphenyl)sulfonyl-1,3-thiazol-2-amine.
| Compound Name | N-methyl-5-(3,4,5-trimethoxyphenyl)sulfonyl-1,3-thiazol-2-amine |
|---|---|
| PubChem CID | 175606976 |
| Molecular Formula | C13H16N2O5S2 |
| Molecular Weight | 344.41 g/mol |
| Exact Mass | 344.05 |
| IUPAC Name | N-methyl-5-(3,4,5-trimethoxyphenyl)sulfonyl-1,3-thiazol-2-amine |
| SMILES | CNc1ncc(S(=O)(=O)c2cc(OC)c(OC)c(OC)c2)s1 |
| InChI | InChI=1S/C13H16N2O5S2/c1-14-13-15-7-11(21-13)22(16,17)8-5-9(18-2)12(20-4)10(6-8)19-3/h5-7H,1-4H3,(H,14,15) |
| InChIKey | LVAPNNRDWKALSF-UHFFFAOYSA-N |
| XLogP | 2.04 |
| TPSA | 86.75 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 22 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 344.41 |
| LogP ≤ 5 | 2.04 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 8 |